About 2,2-dimethylpropane;5-methyl-2-phenylpyridine
2,2-dimethylpropane;5-methyl-2-phenylpyridine (PubChem CID 143955006) has the molecular formula C17H23N
and a molecular weight of 241.38 g/mol. Its IUPAC name is 2,2-dimethylpropane;5-methyl-2-phenylpyridine.
Molecular Properties
| Compound Name | 2,2-dimethylpropane;5-methyl-2-phenylpyridine |
| PubChem CID | 143955006 |
| Molecular Formula | C17H23N |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | 2,2-dimethylpropane;5-methyl-2-phenylpyridine |
| SMILES | CC(C)(C)C.Cc1ccc(-c2ccccc2)nc1 |
| InChI | InChI=1S/C12H11N.C5H12/c1-10-7-8-12(13-9-10)11-5-3-2-4-6-11;1-5(2,3)4/h2-9H,1H3;1-4H3 |
| InChIKey | LXWFUIYOZRMDHA-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,2-dimethylpropane;5-methyl-2-phenylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethylpropane;5-methyl-2-phenylpyridine?
The IUPAC name of 2,2-dimethylpropane;5-methyl-2-phenylpyridine (CID 143955006) is 2,2-dimethylpropane;5-methyl-2-phenylpyridine.
What is the SMILES notation for 2,2-dimethylpropane;5-methyl-2-phenylpyridine?
The canonical SMILES for 2,2-dimethylpropane;5-methyl-2-phenylpyridine is CC(C)(C)C.Cc1ccc(-c2ccccc2)nc1.
What is the InChIKey of 2,2-dimethylpropane;5-methyl-2-phenylpyridine?
The InChIKey is LXWFUIYOZRMDHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N.C5H12/c1-10-7-8-12(13-9-10)11-5-3-2-4-6-11;1-5(2,3)4/h2-9H,1H3;1-4H3.
What are the key properties of 2,2-dimethylpropane;5-methyl-2-phenylpyridine?
2,2-dimethylpropane;5-methyl-2-phenylpyridine has a molecular weight of 241.38 g/mol, XLogP of 5.11, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethylpropane;5-methyl-2-phenylpyridine is sourced from PubChem (CID 143955006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).