About 3-methoxy-2H-quinazoline
3-methoxy-2H-quinazoline (PubChem CID 143955533) has the molecular formula C9H10N2O
and a molecular weight of 162.19 g/mol. Its IUPAC name is 3-methoxy-2H-quinazoline.
Molecular Properties
| Compound Name | 3-methoxy-2H-quinazoline |
| PubChem CID | 143955533 |
| Molecular Formula | C9H10N2O |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 3-methoxy-2H-quinazoline |
| SMILES | CON1C=c2ccccc2=NC1 |
| InChI | InChI=1S/C9H10N2O/c1-12-11-6-8-4-2-3-5-9(8)10-7-11/h2-6H,7H2,1H3 |
| InChIKey | VXDCWYZHXAMVGQ-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methoxy-2H-quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-2H-quinazoline?
The IUPAC name of 3-methoxy-2H-quinazoline (CID 143955533) is 3-methoxy-2H-quinazoline.
What is the SMILES notation for 3-methoxy-2H-quinazoline?
The canonical SMILES for 3-methoxy-2H-quinazoline is CON1C=c2ccccc2=NC1.
What is the InChIKey of 3-methoxy-2H-quinazoline?
The InChIKey is VXDCWYZHXAMVGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O/c1-12-11-6-8-4-2-3-5-9(8)10-7-11/h2-6H,7H2,1H3.
What are the key properties of 3-methoxy-2H-quinazoline?
3-methoxy-2H-quinazoline has a molecular weight of 162.19 g/mol, XLogP of -0.12, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-2H-quinazoline is sourced from PubChem (CID 143955533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).