C15H15F3N2 — CID 143955750
5-[1-[2-(trifluoromethyl)phenyl]ethenyl]-2,3,4,6-tetrahydro-1H-pyrrolo[3,4-c]pyrrole (PubChem CID 143955750) has the molecular formula C15H15F3N2 and a molecular weight of 280.29 g/mol. Its IUPAC name is 5-[1-[2-(trifluoromethyl)phenyl]ethenyl]-2,3,4,6-tetrahydro-1H-pyrrolo[3,4-c]pyrrole.
| Compound Name | 5-[1-[2-(trifluoromethyl)phenyl]ethenyl]-2,3,4,6-tetrahydro-1H-pyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 143955750 |
| Molecular Formula | C15H15F3N2 |
| Molecular Weight | 280.29 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 5-[1-[2-(trifluoromethyl)phenyl]ethenyl]-2,3,4,6-tetrahydro-1H-pyrrolo[3,4-c]pyrrole |
| SMILES | C=C(c1ccccc1C(F)(F)F)N1CC2=C(CNC2)C1 |
| InChI | InChI=1S/C15H15F3N2/c1-10(20-8-11-6-19-7-12(11)9-20)13-4-2-3-5-14(13)15(16,17)18/h2-5,19H,1,6-9H2 |
| InChIKey | PCEJSYHDAMOKMJ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.29 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|