C13H18N2 — CID 143956481
(1Z,3E)-2-(cyclohexa-2,4-dien-1-ylideneamino)-N,N-dimethylpenta-1,3-dien-1-amine (PubChem CID 143956481) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is (1Z,3E)-2-(cyclohexa-2,4-dien-1-ylideneamino)-N,N-dimethylpenta-1,3-dien-1-amine.
| Compound Name | (1Z,3E)-2-(cyclohexa-2,4-dien-1-ylideneamino)-N,N-dimethylpenta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 143956481 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | (1Z,3E)-2-(cyclohexa-2,4-dien-1-ylideneamino)-N,N-dimethylpenta-1,3-dien-1-amine |
| SMILES | C/C=C/C(=C/N(C)C)/N=C1/C=CC=CC1 |
| InChI | InChI=1S/C13H18N2/c1-4-8-13(11-15(2)3)14-12-9-6-5-7-10-12/h4-9,11H,10H2,1-3H3/b8-4+,13-11-,14-12- |
| InChIKey | MJLFDBYMKSTIIR-OSKFZIFBSA-N |
| XLogP | 2.92 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|