About (2Z,4Z)-2-(2-oxopropylideneamino)hexa-2,4-dienal
(2Z,4Z)-2-(2-oxopropylideneamino)hexa-2,4-dienal (PubChem CID 143956499) has the molecular formula C9H11NO2
and a molecular weight of 165.19 g/mol. Its IUPAC name is (2Z,4Z)-2-(2-oxopropylideneamino)hexa-2,4-dienal.
Molecular Properties
| Compound Name | (2Z,4Z)-2-(2-oxopropylideneamino)hexa-2,4-dienal |
| PubChem CID | 143956499 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | (2Z,4Z)-2-(2-oxopropylideneamino)hexa-2,4-dienal |
| SMILES | C/C=C\C=C(C=O)/N=C/C(C)=O |
| InChI | InChI=1S/C9H11NO2/c1-3-4-5-9(7-11)10-6-8(2)12/h3-7H,1-2H3/b4-3-,9-5-,10-6+ |
| InChIKey | IYQODZMIFXUYNH-JECLKBBZSA-N |
| XLogP | 1.31 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2Z,4Z)-2-(2-oxopropylideneamino)hexa-2,4-dienal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,4Z)-2-(2-oxopropylideneamino)hexa-2,4-dienal?
The IUPAC name of (2Z,4Z)-2-(2-oxopropylideneamino)hexa-2,4-dienal (CID 143956499) is (2Z,4Z)-2-(2-oxopropylideneamino)hexa-2,4-dienal.
What is the SMILES notation for (2Z,4Z)-2-(2-oxopropylideneamino)hexa-2,4-dienal?
The canonical SMILES for (2Z,4Z)-2-(2-oxopropylideneamino)hexa-2,4-dienal is C/C=C\C=C(C=O)/N=C/C(C)=O.
What is the InChIKey of (2Z,4Z)-2-(2-oxopropylideneamino)hexa-2,4-dienal?
The InChIKey is IYQODZMIFXUYNH-JECLKBBZSA-N. The full InChI is InChI=1S/C9H11NO2/c1-3-4-5-9(7-11)10-6-8(2)12/h3-7H,1-2H3/b4-3-,9-5-,10-6+.
What are the key properties of (2Z,4Z)-2-(2-oxopropylideneamino)hexa-2,4-dienal?
(2Z,4Z)-2-(2-oxopropylideneamino)hexa-2,4-dienal has a molecular weight of 165.19 g/mol, XLogP of 1.31, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,4Z)-2-(2-oxopropylideneamino)hexa-2,4-dienal is sourced from PubChem (CID 143956499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).