About 4,6-dimethyl-1,2-benzothiazole-3-carboxamide;ethane
4,6-dimethyl-1,2-benzothiazole-3-carboxamide;ethane (PubChem CID 143956587) has the molecular formula C14H22N2OS
and a molecular weight of 266.41 g/mol. Its IUPAC name is 4,6-dimethyl-1,2-benzothiazole-3-carboxamide;ethane.
Molecular Properties
| Compound Name | 4,6-dimethyl-1,2-benzothiazole-3-carboxamide;ethane |
| PubChem CID | 143956587 |
| Molecular Formula | C14H22N2OS |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 4,6-dimethyl-1,2-benzothiazole-3-carboxamide;ethane |
| SMILES | CC.CC.Cc1cc(C)c2c(C(N)=O)nsc2c1 |
| InChI | InChI=1S/C10H10N2OS.2C2H6/c1-5-3-6(2)8-7(4-5)14-12-9(8)10(11)13;2*1-2/h3-4H,1-2H3,(H2,11,13);2*1-2H3 |
| InChIKey | OFXQGIVHALAMIC-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,6-dimethyl-1,2-benzothiazole-3-carboxamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dimethyl-1,2-benzothiazole-3-carboxamide;ethane?
The IUPAC name of 4,6-dimethyl-1,2-benzothiazole-3-carboxamide;ethane (CID 143956587) is 4,6-dimethyl-1,2-benzothiazole-3-carboxamide;ethane.
What is the SMILES notation for 4,6-dimethyl-1,2-benzothiazole-3-carboxamide;ethane?
The canonical SMILES for 4,6-dimethyl-1,2-benzothiazole-3-carboxamide;ethane is CC.CC.Cc1cc(C)c2c(C(N)=O)nsc2c1.
What is the InChIKey of 4,6-dimethyl-1,2-benzothiazole-3-carboxamide;ethane?
The InChIKey is OFXQGIVHALAMIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2OS.2C2H6/c1-5-3-6(2)8-7(4-5)14-12-9(8)10(11)13;2*1-2/h3-4H,1-2H3,(H2,11,13);2*1-2H3.
What are the key properties of 4,6-dimethyl-1,2-benzothiazole-3-carboxamide;ethane?
4,6-dimethyl-1,2-benzothiazole-3-carboxamide;ethane has a molecular weight of 266.41 g/mol, XLogP of 4.06, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dimethyl-1,2-benzothiazole-3-carboxamide;ethane is sourced from PubChem (CID 143956587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).