About tert-butyl N-[(2E)-5,5-diphenylpenta-2,4-dienyl]carbamate
tert-butyl N-[(2E)-5,5-diphenylpenta-2,4-dienyl]carbamate (PubChem CID 14395679) has the molecular formula C22H25NO2
and a molecular weight of 335.45 g/mol. Its IUPAC name is tert-butyl N-[(2E)-5,5-diphenylpenta-2,4-dienyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(2E)-5,5-diphenylpenta-2,4-dienyl]carbamate |
| PubChem CID | 14395679 |
| Molecular Formula | C22H25NO2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | tert-butyl N-[(2E)-5,5-diphenylpenta-2,4-dienyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC/C=C/C=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H25NO2/c1-22(2,3)25-21(24)23-17-11-10-16-20(18-12-6-4-7-13-18)19-14-8-5-9-15-19/h4-16H,17H2,1-3H3,(H,23,24)/b11-10+ |
| InChIKey | CIMCYGYTFSBEIG-ZHACJKMWSA-N |
| XLogP | 5.20 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[(2E)-5,5-diphenylpenta-2,4-dienyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(2E)-5,5-diphenylpenta-2,4-dienyl]carbamate?
The IUPAC name of tert-butyl N-[(2E)-5,5-diphenylpenta-2,4-dienyl]carbamate (CID 14395679) is tert-butyl N-[(2E)-5,5-diphenylpenta-2,4-dienyl]carbamate.
What is the SMILES notation for tert-butyl N-[(2E)-5,5-diphenylpenta-2,4-dienyl]carbamate?
The canonical SMILES for tert-butyl N-[(2E)-5,5-diphenylpenta-2,4-dienyl]carbamate is CC(C)(C)OC(=O)NC/C=C/C=C(c1ccccc1)c1ccccc1.
What is the InChIKey of tert-butyl N-[(2E)-5,5-diphenylpenta-2,4-dienyl]carbamate?
The InChIKey is CIMCYGYTFSBEIG-ZHACJKMWSA-N. The full InChI is InChI=1S/C22H25NO2/c1-22(2,3)25-21(24)23-17-11-10-16-20(18-12-6-4-7-13-18)19-14-8-5-9-15-19/h4-16H,17H2,1-3H3,(H,23,24)/b11-10+.
What are the key properties of tert-butyl N-[(2E)-5,5-diphenylpenta-2,4-dienyl]carbamate?
tert-butyl N-[(2E)-5,5-diphenylpenta-2,4-dienyl]carbamate has a molecular weight of 335.45 g/mol, XLogP of 5.20, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(2E)-5,5-diphenylpenta-2,4-dienyl]carbamate is sourced from PubChem (CID 14395679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).