C23H48N4O11 — CID 143957004
(2S,5S)-6-(aminomethyl)oxane-2,4,5-triol;(2S,5S,6S)-6-(aminomethyl)oxane-2,4,5-triol;[5-(3,5-diaminocyclohexyl)oxyoxolan-2-yl]methanol (PubChem CID 143957004) has the molecular formula C23H48N4O11 and a molecular weight of 556.65 g/mol. Its IUPAC name is (2S,5S)-6-(aminomethyl)oxane-2,4,5-triol;(2S,5S,6S)-6-(aminomethyl)oxane-2,4,5-triol;[5-(3,5-diaminocyclohexyl)oxyoxolan-2-yl]methanol.
| Compound Name | (2S,5S)-6-(aminomethyl)oxane-2,4,5-triol;(2S,5S,6S)-6-(aminomethyl)oxane-2,4,5-triol;[5-(3,5-diaminocyclohexyl)oxyoxolan-2-yl]methanol |
|---|---|
| PubChem CID | 143957004 |
| Molecular Formula | C23H48N4O11 |
| Molecular Weight | 556.65 g/mol |
| Exact Mass | 556.33 |
| IUPAC Name | (2S,5S)-6-(aminomethyl)oxane-2,4,5-triol;(2S,5S,6S)-6-(aminomethyl)oxane-2,4,5-triol;[5-(3,5-diaminocyclohexyl)oxyoxolan-2-yl]methanol |
| SMILES | NC1CC(N)CC(OC2CCC(CO)O2)C1.NCC1O[C@H](O)CC(O)[C@@H]1O.NC[C@@H]1O[C@H](O)CC(O)[C@@H]1O |
| InChI | InChI=1S/C11H22N2O3.2C6H13NO4/c12-7-3-8(13)5-10(4-7)16-11-2-1-9(6-14)15-11;2*7-2-4-6(10)3(8)1-5(9)11-4/h7-11,14H,1-6,12-13H2;2*3-6,8-10H,1-2,7H2/t;3?,4?,5-,6-;3?,4-,5-,6-/m.00/s1 |
| InChIKey | WVAKZIKEUONPKU-UVCSTNHQSA-N |
| XLogP | -4.74 |
| TPSA | 282.61 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.65 |
| LogP ≤ 5 | -4.74 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 15 |