C20H21F4N5 — CID 143957573
4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-2-methyl-8-(1,1,2,2-tetrafluoroethyl)pyrazolo[3,4-c]quinoline (PubChem CID 143957573) has the molecular formula C20H21F4N5 and a molecular weight of 407.42 g/mol. Its IUPAC name is 4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-2-methyl-8-(1,1,2,2-tetrafluoroethyl)pyrazolo[3,4-c]quinoline.
| Compound Name | 4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-2-methyl-8-(1,1,2,2-tetrafluoroethyl)pyrazolo[3,4-c]quinoline |
|---|---|
| PubChem CID | 143957573 |
| Molecular Formula | C20H21F4N5 |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | 4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-2-methyl-8-(1,1,2,2-tetrafluoroethyl)pyrazolo[3,4-c]quinoline |
| SMILES | Cn1cc2c(n1)c(N1CCN3CCCC3C1)nc1ccc(C(F)(F)C(F)F)cc12 |
| InChI | InChI=1S/C20H21F4N5/c1-27-11-15-14-9-12(20(23,24)19(21)22)4-5-16(14)25-18(17(15)26-27)29-8-7-28-6-2-3-13(28)10-29/h4-5,9,11,13,19H,2-3,6-8,10H2,1H3 |
| InChIKey | ULVWPWRUNQZULR-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|