C18H17F5N6 — CID 143957617
4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-6-fluoro-8-(1,1,2,2-tetrafluoroethyl)-[1,2,4]triazolo[1,5-a]quinoxaline (PubChem CID 143957617) has the molecular formula C18H17F5N6 and a molecular weight of 412.37 g/mol. Its IUPAC name is 4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-6-fluoro-8-(1,1,2,2-tetrafluoroethyl)-[1,2,4]triazolo[1,5-a]quinoxaline.
| Compound Name | 4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-6-fluoro-8-(1,1,2,2-tetrafluoroethyl)-[1,2,4]triazolo[1,5-a]quinoxaline |
|---|---|
| PubChem CID | 143957617 |
| Molecular Formula | C18H17F5N6 |
| Molecular Weight | 412.37 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | 4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-6-fluoro-8-(1,1,2,2-tetrafluoroethyl)-[1,2,4]triazolo[1,5-a]quinoxaline |
| SMILES | Fc1cc(C(F)(F)C(F)F)cc2c1nc(N1CCN3CCCC3C1)c1ncnn12 |
| InChI | InChI=1S/C18H17F5N6/c19-12-6-10(18(22,23)17(20)21)7-13-14(12)26-16(15-24-9-25-29(13)15)28-5-4-27-3-1-2-11(27)8-28/h6-7,9,11,17H,1-5,8H2 |
| InChIKey | YSSNKHLRBGPOLV-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 49.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.37 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|