About tert-butyl 2-(3,3-dimethylpentylideneamino)acetate
tert-butyl 2-(3,3-dimethylpentylideneamino)acetate (PubChem CID 143958844) has the molecular formula C13H25NO2
and a molecular weight of 227.35 g/mol. Its IUPAC name is tert-butyl 2-(3,3-dimethylpentylideneamino)acetate.
Molecular Properties
| Compound Name | tert-butyl 2-(3,3-dimethylpentylideneamino)acetate |
| PubChem CID | 143958844 |
| Molecular Formula | C13H25NO2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.19 |
| IUPAC Name | tert-butyl 2-(3,3-dimethylpentylideneamino)acetate |
| SMILES | CCC(C)(C)C/C=N/CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H25NO2/c1-7-13(5,6)8-9-14-10-11(15)16-12(2,3)4/h9H,7-8,10H2,1-6H3/b14-9+ |
| InChIKey | LFOXROIVDZYBKS-NTEUORMPSA-N |
| XLogP | 3.23 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-(3,3-dimethylpentylideneamino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-(3,3-dimethylpentylideneamino)acetate?
The IUPAC name of tert-butyl 2-(3,3-dimethylpentylideneamino)acetate (CID 143958844) is tert-butyl 2-(3,3-dimethylpentylideneamino)acetate.
What is the SMILES notation for tert-butyl 2-(3,3-dimethylpentylideneamino)acetate?
The canonical SMILES for tert-butyl 2-(3,3-dimethylpentylideneamino)acetate is CCC(C)(C)C/C=N/CC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 2-(3,3-dimethylpentylideneamino)acetate?
The InChIKey is LFOXROIVDZYBKS-NTEUORMPSA-N. The full InChI is InChI=1S/C13H25NO2/c1-7-13(5,6)8-9-14-10-11(15)16-12(2,3)4/h9H,7-8,10H2,1-6H3/b14-9+.
What are the key properties of tert-butyl 2-(3,3-dimethylpentylideneamino)acetate?
tert-butyl 2-(3,3-dimethylpentylideneamino)acetate has a molecular weight of 227.35 g/mol, XLogP of 3.23, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-(3,3-dimethylpentylideneamino)acetate is sourced from PubChem (CID 143958844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).