C8H11NO — CID 143959899
(2Z,4E,6Z)-4-aminoocta-2,4,6-trienal (PubChem CID 143959899) has the molecular formula C8H11NO and a molecular weight of 137.18 g/mol. Its IUPAC name is (2Z,4E,6Z)-4-aminoocta-2,4,6-trienal.
| Compound Name | (2Z,4E,6Z)-4-aminoocta-2,4,6-trienal |
|---|---|
| PubChem CID | 143959899 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | (2Z,4E,6Z)-4-aminoocta-2,4,6-trienal |
| SMILES | C/C=C\C=C(N)/C=C\C=O |
| InChI | InChI=1S/C8H11NO/c1-2-3-5-8(9)6-4-7-10/h2-7H,9H2,1H3/b3-2-,6-4-,8-5+ |
| InChIKey | ZVGLXSSUBBZALA-ZVMWILNTSA-N |
| XLogP | 1.16 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|