ethyl 2-(6,6-dimethyl-2-oxo-3-bicyclo[3.1.1]heptanyl)acetate

C13H20O3 — CID 14396104

IUPACethyl 2-(6,6-dimethyl-2-oxo-3-bicyclo[3.1.1]heptanyl)acetate
SMILESCCOC(=O)CC1CC2CC(C1=O)C2(C)C
InChIInChI=1S/C13H20O3/c1-4-16-11(14)6-8-5-9-7-10(12(8)15)13(9,2)3/h8-10H,4-7H2,1-3H3
InChIKeyUOJCEOGWSBQHDC-UHFFFAOYSA-N
MW224.30 g/mol
LogP2.19
Rot. Bonds3

About ethyl 2-(6,6-dimethyl-2-oxo-3-bicyclo[3.1.1]heptanyl)acetate

ethyl 2-(6,6-dimethyl-2-oxo-3-bicyclo[3.1.1]heptanyl)acetate (PubChem CID 14396104) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is ethyl 2-(6,6-dimethyl-2-oxo-3-bicyclo[3.1.1]heptanyl)acetate.

Molecular Properties

Compound Nameethyl 2-(6,6-dimethyl-2-oxo-3-bicyclo[3.1.1]heptanyl)acetate
PubChem CID14396104
Molecular FormulaC13H20O3
Molecular Weight224.30 g/mol
Exact Mass224.14
IUPAC Nameethyl 2-(6,6-dimethyl-2-oxo-3-bicyclo[3.1.1]heptanyl)acetate
SMILESCCOC(=O)CC1CC2CC(C1=O)C2(C)C
InChIInChI=1S/C13H20O3/c1-4-16-11(14)6-8-5-9-7-10(12(8)15)13(9,2)3/h8-10H,4-7H2,1-3H3
InChIKeyUOJCEOGWSBQHDC-UHFFFAOYSA-N
XLogP2.19
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500224.30
LogP ≤ 52.19
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze ethyl 2-(6,6-dimethyl-2-oxo-3-bicyclo[3.1.1]heptanyl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 2-(6,6-dimethyl-2-oxo-3-bicyclo[3.1.1]heptanyl)acetate?
The IUPAC name of ethyl 2-(6,6-dimethyl-2-oxo-3-bicyclo[3.1.1]heptanyl)acetate (CID 14396104) is ethyl 2-(6,6-dimethyl-2-oxo-3-bicyclo[3.1.1]heptanyl)acetate.
What is the SMILES notation for ethyl 2-(6,6-dimethyl-2-oxo-3-bicyclo[3.1.1]heptanyl)acetate?
The canonical SMILES for ethyl 2-(6,6-dimethyl-2-oxo-3-bicyclo[3.1.1]heptanyl)acetate is CCOC(=O)CC1CC2CC(C1=O)C2(C)C.
What is the InChIKey of ethyl 2-(6,6-dimethyl-2-oxo-3-bicyclo[3.1.1]heptanyl)acetate?
The InChIKey is UOJCEOGWSBQHDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O3/c1-4-16-11(14)6-8-5-9-7-10(12(8)15)13(9,2)3/h8-10H,4-7H2,1-3H3.
What are the key properties of ethyl 2-(6,6-dimethyl-2-oxo-3-bicyclo[3.1.1]heptanyl)acetate?
ethyl 2-(6,6-dimethyl-2-oxo-3-bicyclo[3.1.1]heptanyl)acetate has a molecular weight of 224.30 g/mol, XLogP of 2.19, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(6,6-dimethyl-2-oxo-3-bicyclo[3.1.1]heptanyl)acetate is sourced from PubChem (CID 14396104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).