About 2-(2-amino-6,6-dimethyl-3-bicyclo[3.1.1]heptanyl)ethanol
2-(2-amino-6,6-dimethyl-3-bicyclo[3.1.1]heptanyl)ethanol (PubChem CID 14396107) has the molecular formula C11H21NO
and a molecular weight of 183.29 g/mol. Its IUPAC name is 2-(2-amino-6,6-dimethyl-3-bicyclo[3.1.1]heptanyl)ethanol.
Molecular Properties
| Compound Name | 2-(2-amino-6,6-dimethyl-3-bicyclo[3.1.1]heptanyl)ethanol |
| PubChem CID | 14396107 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | 2-(2-amino-6,6-dimethyl-3-bicyclo[3.1.1]heptanyl)ethanol |
| SMILES | CC1(C)C2CC(CCO)C(N)C1C2 |
| InChI | InChI=1S/C11H21NO/c1-11(2)8-5-7(3-4-13)10(12)9(11)6-8/h7-10,13H,3-6,12H2,1-2H3 |
| InChIKey | PDPVGSJZVCWIKP-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(2-amino-6,6-dimethyl-3-bicyclo[3.1.1]heptanyl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-amino-6,6-dimethyl-3-bicyclo[3.1.1]heptanyl)ethanol?
The IUPAC name of 2-(2-amino-6,6-dimethyl-3-bicyclo[3.1.1]heptanyl)ethanol (CID 14396107) is 2-(2-amino-6,6-dimethyl-3-bicyclo[3.1.1]heptanyl)ethanol.
What is the SMILES notation for 2-(2-amino-6,6-dimethyl-3-bicyclo[3.1.1]heptanyl)ethanol?
The canonical SMILES for 2-(2-amino-6,6-dimethyl-3-bicyclo[3.1.1]heptanyl)ethanol is CC1(C)C2CC(CCO)C(N)C1C2.
What is the InChIKey of 2-(2-amino-6,6-dimethyl-3-bicyclo[3.1.1]heptanyl)ethanol?
The InChIKey is PDPVGSJZVCWIKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO/c1-11(2)8-5-7(3-4-13)10(12)9(11)6-8/h7-10,13H,3-6,12H2,1-2H3.
What are the key properties of 2-(2-amino-6,6-dimethyl-3-bicyclo[3.1.1]heptanyl)ethanol?
2-(2-amino-6,6-dimethyl-3-bicyclo[3.1.1]heptanyl)ethanol has a molecular weight of 183.29 g/mol, XLogP of 1.38, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-amino-6,6-dimethyl-3-bicyclo[3.1.1]heptanyl)ethanol is sourced from PubChem (CID 14396107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).