About 5-but-3-en-2-ylbenzene-1,2,3-triol
5-but-3-en-2-ylbenzene-1,2,3-triol (PubChem CID 143961077) has the molecular formula C10H12O3
and a molecular weight of 180.20 g/mol. Its IUPAC name is 5-but-3-en-2-ylbenzene-1,2,3-triol.
Molecular Properties
| Compound Name | 5-but-3-en-2-ylbenzene-1,2,3-triol |
| PubChem CID | 143961077 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 5-but-3-en-2-ylbenzene-1,2,3-triol |
| SMILES | C=CC(C)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C10H12O3/c1-3-6(2)7-4-8(11)10(13)9(12)5-7/h3-6,11-13H,1H2,2H3 |
| InChIKey | AASBZDPXPHUGIU-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-but-3-en-2-ylbenzene-1,2,3-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-but-3-en-2-ylbenzene-1,2,3-triol?
The IUPAC name of 5-but-3-en-2-ylbenzene-1,2,3-triol (CID 143961077) is 5-but-3-en-2-ylbenzene-1,2,3-triol.
What is the SMILES notation for 5-but-3-en-2-ylbenzene-1,2,3-triol?
The canonical SMILES for 5-but-3-en-2-ylbenzene-1,2,3-triol is C=CC(C)c1cc(O)c(O)c(O)c1.
What is the InChIKey of 5-but-3-en-2-ylbenzene-1,2,3-triol?
The InChIKey is AASBZDPXPHUGIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O3/c1-3-6(2)7-4-8(11)10(13)9(12)5-7/h3-6,11-13H,1H2,2H3.
What are the key properties of 5-but-3-en-2-ylbenzene-1,2,3-triol?
5-but-3-en-2-ylbenzene-1,2,3-triol has a molecular weight of 180.20 g/mol, XLogP of 2.09, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-but-3-en-2-ylbenzene-1,2,3-triol is sourced from PubChem (CID 143961077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).