About 4-cycloheptyl-N-ethylcyclohepta-2,4-dien-1-amine;ethane
4-cycloheptyl-N-ethylcyclohepta-2,4-dien-1-amine;ethane (PubChem CID 143961293) has the molecular formula C18H33N
and a molecular weight of 263.47 g/mol. Its IUPAC name is 4-cycloheptyl-N-ethylcyclohepta-2,4-dien-1-amine;ethane.
Molecular Properties
| Compound Name | 4-cycloheptyl-N-ethylcyclohepta-2,4-dien-1-amine;ethane |
| PubChem CID | 143961293 |
| Molecular Formula | C18H33N |
| Molecular Weight | 263.47 g/mol |
| Exact Mass | 263.26 |
| IUPAC Name | 4-cycloheptyl-N-ethylcyclohepta-2,4-dien-1-amine;ethane |
| SMILES | CC.CCNC1C=CC(C2CCCCCC2)=CCC1 |
| InChI | InChI=1S/C16H27N.C2H6/c1-2-17-16-11-7-10-15(12-13-16)14-8-5-3-4-6-9-14;1-2/h10,12-14,16-17H,2-9,11H2,1H3;1-2H3 |
| InChIKey | AYDGDKILJNXJRE-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 263.47 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-cycloheptyl-N-ethylcyclohepta-2,4-dien-1-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cycloheptyl-N-ethylcyclohepta-2,4-dien-1-amine;ethane?
The IUPAC name of 4-cycloheptyl-N-ethylcyclohepta-2,4-dien-1-amine;ethane (CID 143961293) is 4-cycloheptyl-N-ethylcyclohepta-2,4-dien-1-amine;ethane.
What is the SMILES notation for 4-cycloheptyl-N-ethylcyclohepta-2,4-dien-1-amine;ethane?
The canonical SMILES for 4-cycloheptyl-N-ethylcyclohepta-2,4-dien-1-amine;ethane is CC.CCNC1C=CC(C2CCCCCC2)=CCC1.
What is the InChIKey of 4-cycloheptyl-N-ethylcyclohepta-2,4-dien-1-amine;ethane?
The InChIKey is AYDGDKILJNXJRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27N.C2H6/c1-2-17-16-11-7-10-15(12-13-16)14-8-5-3-4-6-9-14;1-2/h10,12-14,16-17H,2-9,11H2,1H3;1-2H3.
What are the key properties of 4-cycloheptyl-N-ethylcyclohepta-2,4-dien-1-amine;ethane?
4-cycloheptyl-N-ethylcyclohepta-2,4-dien-1-amine;ethane has a molecular weight of 263.47 g/mol, XLogP of 5.24, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cycloheptyl-N-ethylcyclohepta-2,4-dien-1-amine;ethane is sourced from PubChem (CID 143961293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).