About (2-methylphenyl)methyl N,N'-diamino-N-(2-methylphenyl)carbamimidothioate
(2-methylphenyl)methyl N,N'-diamino-N-(2-methylphenyl)carbamimidothioate (PubChem CID 143961531) has the molecular formula C16H20N4S
and a molecular weight of 300.43 g/mol. Its IUPAC name is (2-methylphenyl)methyl N,N'-diamino-N-(2-methylphenyl)carbamimidothioate.
Molecular Properties
| Compound Name | (2-methylphenyl)methyl N,N'-diamino-N-(2-methylphenyl)carbamimidothioate |
| PubChem CID | 143961531 |
| Molecular Formula | C16H20N4S |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | (2-methylphenyl)methyl N,N'-diamino-N-(2-methylphenyl)carbamimidothioate |
| SMILES | Cc1ccccc1CS/C(=N/N)N(N)c1ccccc1C |
| InChI | InChI=1S/C16H20N4S/c1-12-7-3-5-9-14(12)11-21-16(19-17)20(18)15-10-6-4-8-13(15)2/h3-10H,11,17-18H2,1-2H3/b19-16+ |
| InChIKey | KGIFMISVRHOSIJ-KNTRCKAVSA-N |
| XLogP | 3.15 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-methylphenyl)methyl N,N'-diamino-N-(2-methylphenyl)carbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylphenyl)methyl N,N'-diamino-N-(2-methylphenyl)carbamimidothioate?
The IUPAC name of (2-methylphenyl)methyl N,N'-diamino-N-(2-methylphenyl)carbamimidothioate (CID 143961531) is (2-methylphenyl)methyl N,N'-diamino-N-(2-methylphenyl)carbamimidothioate.
What is the SMILES notation for (2-methylphenyl)methyl N,N'-diamino-N-(2-methylphenyl)carbamimidothioate?
The canonical SMILES for (2-methylphenyl)methyl N,N'-diamino-N-(2-methylphenyl)carbamimidothioate is Cc1ccccc1CS/C(=N/N)N(N)c1ccccc1C.
What is the InChIKey of (2-methylphenyl)methyl N,N'-diamino-N-(2-methylphenyl)carbamimidothioate?
The InChIKey is KGIFMISVRHOSIJ-KNTRCKAVSA-N. The full InChI is InChI=1S/C16H20N4S/c1-12-7-3-5-9-14(12)11-21-16(19-17)20(18)15-10-6-4-8-13(15)2/h3-10H,11,17-18H2,1-2H3/b19-16+.
What are the key properties of (2-methylphenyl)methyl N,N'-diamino-N-(2-methylphenyl)carbamimidothioate?
(2-methylphenyl)methyl N,N'-diamino-N-(2-methylphenyl)carbamimidothioate has a molecular weight of 300.43 g/mol, XLogP of 3.15, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylphenyl)methyl N,N'-diamino-N-(2-methylphenyl)carbamimidothioate is sourced from PubChem (CID 143961531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).