About 2-[2-(difluoromethoxy)phenyl]-4-(1H-pyrrol-2-yl)-2,3-dihydro-1,5-benzothiazepine
2-[2-(difluoromethoxy)phenyl]-4-(1H-pyrrol-2-yl)-2,3-dihydro-1,5-benzothiazepine (PubChem CID 143961597) has the molecular formula C20H16F2N2OS
and a molecular weight of 370.42 g/mol. Its IUPAC name is 2-[2-(difluoromethoxy)phenyl]-4-(1H-pyrrol-2-yl)-2,3-dihydro-1,5-benzothiazepine.
Molecular Properties
| Compound Name | 2-[2-(difluoromethoxy)phenyl]-4-(1H-pyrrol-2-yl)-2,3-dihydro-1,5-benzothiazepine |
| PubChem CID | 143961597 |
| Molecular Formula | C20H16F2N2OS |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | 2-[2-(difluoromethoxy)phenyl]-4-(1H-pyrrol-2-yl)-2,3-dihydro-1,5-benzothiazepine |
| SMILES | FC(F)Oc1ccccc1C1CC(c2ccc[nH]2)=Nc2ccccc2S1 |
| InChI | InChI=1S/C20H16F2N2OS/c21-20(22)25-17-9-3-1-6-13(17)19-12-16(14-8-5-11-23-14)24-15-7-2-4-10-18(15)26-19/h1-11,19-20,23H,12H2 |
| InChIKey | BADOQPOBULRBPP-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 37.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[2-(difluoromethoxy)phenyl]-4-(1H-pyrrol-2-yl)-2,3-dihydro-1,5-benzothiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(difluoromethoxy)phenyl]-4-(1H-pyrrol-2-yl)-2,3-dihydro-1,5-benzothiazepine?
The IUPAC name of 2-[2-(difluoromethoxy)phenyl]-4-(1H-pyrrol-2-yl)-2,3-dihydro-1,5-benzothiazepine (CID 143961597) is 2-[2-(difluoromethoxy)phenyl]-4-(1H-pyrrol-2-yl)-2,3-dihydro-1,5-benzothiazepine.
What is the SMILES notation for 2-[2-(difluoromethoxy)phenyl]-4-(1H-pyrrol-2-yl)-2,3-dihydro-1,5-benzothiazepine?
The canonical SMILES for 2-[2-(difluoromethoxy)phenyl]-4-(1H-pyrrol-2-yl)-2,3-dihydro-1,5-benzothiazepine is FC(F)Oc1ccccc1C1CC(c2ccc[nH]2)=Nc2ccccc2S1.
What is the InChIKey of 2-[2-(difluoromethoxy)phenyl]-4-(1H-pyrrol-2-yl)-2,3-dihydro-1,5-benzothiazepine?
The InChIKey is BADOQPOBULRBPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16F2N2OS/c21-20(22)25-17-9-3-1-6-13(17)19-12-16(14-8-5-11-23-14)24-15-7-2-4-10-18(15)26-19/h1-11,19-20,23H,12H2.
What are the key properties of 2-[2-(difluoromethoxy)phenyl]-4-(1H-pyrrol-2-yl)-2,3-dihydro-1,5-benzothiazepine?
2-[2-(difluoromethoxy)phenyl]-4-(1H-pyrrol-2-yl)-2,3-dihydro-1,5-benzothiazepine has a molecular weight of 370.42 g/mol, XLogP of 5.97, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(difluoromethoxy)phenyl]-4-(1H-pyrrol-2-yl)-2,3-dihydro-1,5-benzothiazepine is sourced from PubChem (CID 143961597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).