About N-[(Z)-1-[amino(4-methylpentyl)amino]oct-1-en-2-yl]methanimine;ethane;methanimine
N-[(Z)-1-[amino(4-methylpentyl)amino]oct-1-en-2-yl]methanimine;ethane;methanimine (PubChem CID 143961676) has the molecular formula C18H40N4
and a molecular weight of 312.55 g/mol. Its IUPAC name is N-[(Z)-1-[amino(4-methylpentyl)amino]oct-1-en-2-yl]methanimine;ethane;methanimine.
Molecular Properties
| Compound Name | N-[(Z)-1-[amino(4-methylpentyl)amino]oct-1-en-2-yl]methanimine;ethane;methanimine |
| PubChem CID | 143961676 |
| Molecular Formula | C18H40N4 |
| Molecular Weight | 312.55 g/mol |
| Exact Mass | 312.33 |
| IUPAC Name | N-[(Z)-1-[amino(4-methylpentyl)amino]oct-1-en-2-yl]methanimine;ethane;methanimine |
| SMILES | C=N/C(=C\N(N)CCCC(C)C)CCCCCC.CC.[H]N=C |
| InChI | InChI=1S/C15H31N3.C2H6.CH3N/c1-5-6-7-8-11-15(17-4)13-18(16)12-9-10-14(2)3;2*1-2/h13-14H,4-12,16H2,1-3H3;1-2H3;2H,1H2/b15-13-;; |
| InChIKey | IYRAIMCBZIVDKN-FQGJLALVSA-N |
| XLogP | 5.40 |
| TPSA | 65.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 312.55 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-1-[amino(4-methylpentyl)amino]oct-1-en-2-yl]methanimine;ethane;methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-1-[amino(4-methylpentyl)amino]oct-1-en-2-yl]methanimine;ethane;methanimine?
The IUPAC name of N-[(Z)-1-[amino(4-methylpentyl)amino]oct-1-en-2-yl]methanimine;ethane;methanimine (CID 143961676) is N-[(Z)-1-[amino(4-methylpentyl)amino]oct-1-en-2-yl]methanimine;ethane;methanimine.
What is the SMILES notation for N-[(Z)-1-[amino(4-methylpentyl)amino]oct-1-en-2-yl]methanimine;ethane;methanimine?
The canonical SMILES for N-[(Z)-1-[amino(4-methylpentyl)amino]oct-1-en-2-yl]methanimine;ethane;methanimine is C=N/C(=C\N(N)CCCC(C)C)CCCCCC.CC.[H]N=C.
What is the InChIKey of N-[(Z)-1-[amino(4-methylpentyl)amino]oct-1-en-2-yl]methanimine;ethane;methanimine?
The InChIKey is IYRAIMCBZIVDKN-FQGJLALVSA-N. The full InChI is InChI=1S/C15H31N3.C2H6.CH3N/c1-5-6-7-8-11-15(17-4)13-18(16)12-9-10-14(2)3;2*1-2/h13-14H,4-12,16H2,1-3H3;1-2H3;2H,1H2/b15-13-;;.
What are the key properties of N-[(Z)-1-[amino(4-methylpentyl)amino]oct-1-en-2-yl]methanimine;ethane;methanimine?
N-[(Z)-1-[amino(4-methylpentyl)amino]oct-1-en-2-yl]methanimine;ethane;methanimine has a molecular weight of 312.55 g/mol, XLogP of 5.40, 11 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-1-[amino(4-methylpentyl)amino]oct-1-en-2-yl]methanimine;ethane;methanimine is sourced from PubChem (CID 143961676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).