C16H27N2O4+ — CID 143961892
[1-[(3aS)-6-ethynyl-3,3-dimethoxy-3a,5,6,6a-tetrahydro-2H-furo[3,2-b]pyrrol-4-yl]-4-methyl-1-oxopentan-2-yl]azanium (PubChem CID 143961892) has the molecular formula C16H27N2O4+ and a molecular weight of 311.40 g/mol. Its IUPAC name is [1-[(3aS)-6-ethynyl-3,3-dimethoxy-3a,5,6,6a-tetrahydro-2H-furo[3,2-b]pyrrol-4-yl]-4-methyl-1-oxopentan-2-yl]azanium.
| Compound Name | [1-[(3aS)-6-ethynyl-3,3-dimethoxy-3a,5,6,6a-tetrahydro-2H-furo[3,2-b]pyrrol-4-yl]-4-methyl-1-oxopentan-2-yl]azanium |
|---|---|
| PubChem CID | 143961892 |
| Molecular Formula | C16H27N2O4+ |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | [1-[(3aS)-6-ethynyl-3,3-dimethoxy-3a,5,6,6a-tetrahydro-2H-furo[3,2-b]pyrrol-4-yl]-4-methyl-1-oxopentan-2-yl]azanium |
| SMILES | C#CC1CN(C(=O)C([NH3+])CC(C)C)[C@H]2C1OCC2(OC)OC |
| InChI | InChI=1S/C16H26N2O4/c1-6-11-8-18(15(19)12(17)7-10(2)3)14-13(11)22-9-16(14,20-4)21-5/h1,10-14H,7-9,17H2,2-5H3/p+1/t11?,12?,13?,14-/m0/s1 |
| InChIKey | LUGPWHAVFQLSSY-XOZUOACSSA-O |
| XLogP | -0.51 |
| TPSA | 75.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|