About 2-amino-5-(trifluoromethyl)phenol;4-(4-methoxy-1,3-benzothiazol-2-yl)aniline
2-amino-5-(trifluoromethyl)phenol;4-(4-methoxy-1,3-benzothiazol-2-yl)aniline (PubChem CID 143962381) has the molecular formula C21H18F3N3O2S
and a molecular weight of 433.46 g/mol. Its IUPAC name is 2-amino-5-(trifluoromethyl)phenol;4-(4-methoxy-1,3-benzothiazol-2-yl)aniline.
Molecular Properties
| Compound Name | 2-amino-5-(trifluoromethyl)phenol;4-(4-methoxy-1,3-benzothiazol-2-yl)aniline |
| PubChem CID | 143962381 |
| Molecular Formula | C21H18F3N3O2S |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | 2-amino-5-(trifluoromethyl)phenol;4-(4-methoxy-1,3-benzothiazol-2-yl)aniline |
| SMILES | COc1cccc2sc(-c3ccc(N)cc3)nc12.Nc1ccc(C(F)(F)F)cc1O |
| InChI | InChI=1S/C14H12N2OS.C7H6F3NO/c1-17-11-3-2-4-12-13(11)16-14(18-12)9-5-7-10(15)8-6-9;8-7(9,10)4-1-2-5(11)6(12)3-4/h2-8H,15H2,1H3;1-3,12H,11H2 |
| InChIKey | QQCXHIBLSIDFEZ-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 94.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-5-(trifluoromethyl)phenol;4-(4-methoxy-1,3-benzothiazol-2-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-5-(trifluoromethyl)phenol;4-(4-methoxy-1,3-benzothiazol-2-yl)aniline?
The IUPAC name of 2-amino-5-(trifluoromethyl)phenol;4-(4-methoxy-1,3-benzothiazol-2-yl)aniline (CID 143962381) is 2-amino-5-(trifluoromethyl)phenol;4-(4-methoxy-1,3-benzothiazol-2-yl)aniline.
What is the SMILES notation for 2-amino-5-(trifluoromethyl)phenol;4-(4-methoxy-1,3-benzothiazol-2-yl)aniline?
The canonical SMILES for 2-amino-5-(trifluoromethyl)phenol;4-(4-methoxy-1,3-benzothiazol-2-yl)aniline is COc1cccc2sc(-c3ccc(N)cc3)nc12.Nc1ccc(C(F)(F)F)cc1O.
What is the InChIKey of 2-amino-5-(trifluoromethyl)phenol;4-(4-methoxy-1,3-benzothiazol-2-yl)aniline?
The InChIKey is QQCXHIBLSIDFEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2OS.C7H6F3NO/c1-17-11-3-2-4-12-13(11)16-14(18-12)9-5-7-10(15)8-6-9;8-7(9,10)4-1-2-5(11)6(12)3-4/h2-8H,15H2,1H3;1-3,12H,11H2.
What are the key properties of 2-amino-5-(trifluoromethyl)phenol;4-(4-methoxy-1,3-benzothiazol-2-yl)aniline?
2-amino-5-(trifluoromethyl)phenol;4-(4-methoxy-1,3-benzothiazol-2-yl)aniline has a molecular weight of 433.46 g/mol, XLogP of 5.55, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5-(trifluoromethyl)phenol;4-(4-methoxy-1,3-benzothiazol-2-yl)aniline is sourced from PubChem (CID 143962381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).