About (2E)-2-(1-aminoethylidene)-3-imino-4,4-dimethylpentanenitrile;ethane
(2E)-2-(1-aminoethylidene)-3-imino-4,4-dimethylpentanenitrile;ethane (PubChem CID 143962785) has the molecular formula C11H21N3
and a molecular weight of 195.31 g/mol. Its IUPAC name is (2E)-2-(1-aminoethylidene)-3-imino-4,4-dimethylpentanenitrile;ethane.
Molecular Properties
| Compound Name | (2E)-2-(1-aminoethylidene)-3-imino-4,4-dimethylpentanenitrile;ethane |
| PubChem CID | 143962785 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | (2E)-2-(1-aminoethylidene)-3-imino-4,4-dimethylpentanenitrile;ethane |
| SMILES | CC.[H]/N=C(C(\C#N)=C(\C)N)/C(C)(C)C |
| InChI | InChI=1S/C9H15N3.C2H6/c1-6(11)7(5-10)8(12)9(2,3)4;1-2/h12H,11H2,1-4H3;1-2H3/b7-6-,12-8+; |
| InChIKey | BHPDBPOFFIUDSB-DBBNAXRXSA-N |
| XLogP | 2.83 |
| TPSA | 73.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-(1-aminoethylidene)-3-imino-4,4-dimethylpentanenitrile;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-(1-aminoethylidene)-3-imino-4,4-dimethylpentanenitrile;ethane?
The IUPAC name of (2E)-2-(1-aminoethylidene)-3-imino-4,4-dimethylpentanenitrile;ethane (CID 143962785) is (2E)-2-(1-aminoethylidene)-3-imino-4,4-dimethylpentanenitrile;ethane.
What is the SMILES notation for (2E)-2-(1-aminoethylidene)-3-imino-4,4-dimethylpentanenitrile;ethane?
The canonical SMILES for (2E)-2-(1-aminoethylidene)-3-imino-4,4-dimethylpentanenitrile;ethane is CC.[H]/N=C(C(\C#N)=C(\C)N)/C(C)(C)C.
What is the InChIKey of (2E)-2-(1-aminoethylidene)-3-imino-4,4-dimethylpentanenitrile;ethane?
The InChIKey is BHPDBPOFFIUDSB-DBBNAXRXSA-N. The full InChI is InChI=1S/C9H15N3.C2H6/c1-6(11)7(5-10)8(12)9(2,3)4;1-2/h12H,11H2,1-4H3;1-2H3/b7-6-,12-8+;.
What are the key properties of (2E)-2-(1-aminoethylidene)-3-imino-4,4-dimethylpentanenitrile;ethane?
(2E)-2-(1-aminoethylidene)-3-imino-4,4-dimethylpentanenitrile;ethane has a molecular weight of 195.31 g/mol, XLogP of 2.83, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-(1-aminoethylidene)-3-imino-4,4-dimethylpentanenitrile;ethane is sourced from PubChem (CID 143962785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).