About ethane;(Z)-4-imino-3,5,5-trimethylhex-2-en-2-amine;molecular hydrogen
ethane;(Z)-4-imino-3,5,5-trimethylhex-2-en-2-amine;molecular hydrogen (PubChem CID 143962808) has the molecular formula C11H26N2
and a molecular weight of 186.34 g/mol. Its IUPAC name is ethane;(Z)-4-imino-3,5,5-trimethylhex-2-en-2-amine;molecular hydrogen.
Molecular Properties
| Compound Name | ethane;(Z)-4-imino-3,5,5-trimethylhex-2-en-2-amine;molecular hydrogen |
| PubChem CID | 143962808 |
| Molecular Formula | C11H26N2 |
| Molecular Weight | 186.34 g/mol |
| Exact Mass | 186.21 |
| IUPAC Name | ethane;(Z)-4-imino-3,5,5-trimethylhex-2-en-2-amine;molecular hydrogen |
| SMILES | CC.[H]/N=C(C(\C)=C(\C)N)/C(C)(C)C.[H][H] |
| InChI | InChI=1S/C9H18N2.C2H6.H2/c1-6(7(2)10)8(11)9(3,4)5;1-2;/h11H,10H2,1-5H3;1-2H3;1H/b7-6-,11-8+;; |
| InChIKey | IJIYSNMUAVSRNS-SQWZQHIMSA-N |
| XLogP | 3.58 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.34 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;(Z)-4-imino-3,5,5-trimethylhex-2-en-2-amine;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(Z)-4-imino-3,5,5-trimethylhex-2-en-2-amine;molecular hydrogen?
The IUPAC name of ethane;(Z)-4-imino-3,5,5-trimethylhex-2-en-2-amine;molecular hydrogen (CID 143962808) is ethane;(Z)-4-imino-3,5,5-trimethylhex-2-en-2-amine;molecular hydrogen.
What is the SMILES notation for ethane;(Z)-4-imino-3,5,5-trimethylhex-2-en-2-amine;molecular hydrogen?
The canonical SMILES for ethane;(Z)-4-imino-3,5,5-trimethylhex-2-en-2-amine;molecular hydrogen is CC.[H]/N=C(C(\C)=C(\C)N)/C(C)(C)C.[H][H].
What is the InChIKey of ethane;(Z)-4-imino-3,5,5-trimethylhex-2-en-2-amine;molecular hydrogen?
The InChIKey is IJIYSNMUAVSRNS-SQWZQHIMSA-N. The full InChI is InChI=1S/C9H18N2.C2H6.H2/c1-6(7(2)10)8(11)9(3,4)5;1-2;/h11H,10H2,1-5H3;1-2H3;1H/b7-6-,11-8+;;.
What are the key properties of ethane;(Z)-4-imino-3,5,5-trimethylhex-2-en-2-amine;molecular hydrogen?
ethane;(Z)-4-imino-3,5,5-trimethylhex-2-en-2-amine;molecular hydrogen has a molecular weight of 186.34 g/mol, XLogP of 3.58, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(Z)-4-imino-3,5,5-trimethylhex-2-en-2-amine;molecular hydrogen is sourced from PubChem (CID 143962808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).