C7H15NO — CID 143962949
(Z)-1-methoxy-N,2-dimethylbut-2-en-1-amine (PubChem CID 143962949) has the molecular formula C7H15NO and a molecular weight of 129.20 g/mol. Its IUPAC name is (Z)-1-methoxy-N,2-dimethylbut-2-en-1-amine.
| Compound Name | (Z)-1-methoxy-N,2-dimethylbut-2-en-1-amine |
|---|---|
| PubChem CID | 143962949 |
| Molecular Formula | C7H15NO |
| Molecular Weight | 129.20 g/mol |
| Exact Mass | 129.12 |
| IUPAC Name | (Z)-1-methoxy-N,2-dimethylbut-2-en-1-amine |
| SMILES | C/C=C(/C)C(NC)OC |
| InChI | InChI=1S/C7H15NO/c1-5-6(2)7(8-3)9-4/h5,7-8H,1-4H3/b6-5- |
| InChIKey | IABSZEVUFMREDU-WAYWQWQTSA-N |
| XLogP | 1.14 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.20 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|