About N-[(5E,6Z)-5-ethylidene-3-methylidenenona-1,6-dien-4-yl]aniline
N-[(5E,6Z)-5-ethylidene-3-methylidenenona-1,6-dien-4-yl]aniline (PubChem CID 143963360) has the molecular formula C18H23N
and a molecular weight of 253.39 g/mol. Its IUPAC name is N-[(5E,6Z)-5-ethylidene-3-methylidenenona-1,6-dien-4-yl]aniline.
Molecular Properties
| Compound Name | N-[(5E,6Z)-5-ethylidene-3-methylidenenona-1,6-dien-4-yl]aniline |
| PubChem CID | 143963360 |
| Molecular Formula | C18H23N |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | N-[(5E,6Z)-5-ethylidene-3-methylidenenona-1,6-dien-4-yl]aniline |
| SMILES | C=CC(=C)C(Nc1ccccc1)C(/C=C\CC)=C/C |
| InChI | InChI=1S/C18H23N/c1-5-8-12-16(7-3)18(15(4)6-2)19-17-13-10-9-11-14-17/h6-14,18-19H,2,4-5H2,1,3H3/b12-8-,16-7+ |
| InChIKey | QYXRILKUUNJGFV-COAJZOOHSA-N |
| XLogP | 5.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(5E,6Z)-5-ethylidene-3-methylidenenona-1,6-dien-4-yl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5E,6Z)-5-ethylidene-3-methylidenenona-1,6-dien-4-yl]aniline?
The IUPAC name of N-[(5E,6Z)-5-ethylidene-3-methylidenenona-1,6-dien-4-yl]aniline (CID 143963360) is N-[(5E,6Z)-5-ethylidene-3-methylidenenona-1,6-dien-4-yl]aniline.
What is the SMILES notation for N-[(5E,6Z)-5-ethylidene-3-methylidenenona-1,6-dien-4-yl]aniline?
The canonical SMILES for N-[(5E,6Z)-5-ethylidene-3-methylidenenona-1,6-dien-4-yl]aniline is C=CC(=C)C(Nc1ccccc1)C(/C=C\CC)=C/C.
What is the InChIKey of N-[(5E,6Z)-5-ethylidene-3-methylidenenona-1,6-dien-4-yl]aniline?
The InChIKey is QYXRILKUUNJGFV-COAJZOOHSA-N. The full InChI is InChI=1S/C18H23N/c1-5-8-12-16(7-3)18(15(4)6-2)19-17-13-10-9-11-14-17/h6-14,18-19H,2,4-5H2,1,3H3/b12-8-,16-7+.
What are the key properties of N-[(5E,6Z)-5-ethylidene-3-methylidenenona-1,6-dien-4-yl]aniline?
N-[(5E,6Z)-5-ethylidene-3-methylidenenona-1,6-dien-4-yl]aniline has a molecular weight of 253.39 g/mol, XLogP of 5.12, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5E,6Z)-5-ethylidene-3-methylidenenona-1,6-dien-4-yl]aniline is sourced from PubChem (CID 143963360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).