C18H23FN6O3 — CID 143963499
N-[[3-[4-(1-cyano-5,6-dihydro-1,2,4-triazin-4-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide;ethane (PubChem CID 143963499) has the molecular formula C18H23FN6O3 and a molecular weight of 390.42 g/mol. Its IUPAC name is N-[[3-[4-(1-cyano-5,6-dihydro-1,2,4-triazin-4-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide;ethane.
| Compound Name | N-[[3-[4-(1-cyano-5,6-dihydro-1,2,4-triazin-4-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide;ethane |
|---|---|
| PubChem CID | 143963499 |
| Molecular Formula | C18H23FN6O3 |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | N-[[3-[4-(1-cyano-5,6-dihydro-1,2,4-triazin-4-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide;ethane |
| SMILES | CC.CC(=O)NCC1CN(c2ccc(N3C=NN(C#N)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C16H17FN6O3.C2H6/c1-11(24)19-7-13-8-23(16(25)26-13)12-2-3-15(14(17)6-12)21-4-5-22(9-18)20-10-21;1-2/h2-3,6,10,13H,4-5,7-8H2,1H3,(H,19,24);1-2H3 |
| InChIKey | DKHGLARCXCNLSC-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 101.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|