C32H37N7O4 — CID 143964561
1-[4-[2-[[2-[4-[2-[ethyl(2-hydroxyethyl)amino]ethoxy]phenyl]-[1,3]oxazolo[5,4-d]pyrimidin-7-yl]amino]ethyl]phenyl]-3-[(3E)-hexa-1,3,5-trien-3-yl]urea (PubChem CID 143964561) has the molecular formula C32H37N7O4 and a molecular weight of 583.69 g/mol. Its IUPAC name is 1-[4-[2-[[2-[4-[2-[ethyl(2-hydroxyethyl)amino]ethoxy]phenyl]-[1,3]oxazolo[5,4-d]pyrimidin-7-yl]amino]ethyl]phenyl]-3-[(3E)-hexa-1,3,5-trien-3-yl]urea.
| Compound Name | 1-[4-[2-[[2-[4-[2-[ethyl(2-hydroxyethyl)amino]ethoxy]phenyl]-[1,3]oxazolo[5,4-d]pyrimidin-7-yl]amino]ethyl]phenyl]-3-[(3E)-hexa-1,3,5-trien-3-yl]urea |
|---|---|
| PubChem CID | 143964561 |
| Molecular Formula | C32H37N7O4 |
| Molecular Weight | 583.69 g/mol |
| Exact Mass | 583.29 |
| IUPAC Name | 1-[4-[2-[[2-[4-[2-[ethyl(2-hydroxyethyl)amino]ethoxy]phenyl]-[1,3]oxazolo[5,4-d]pyrimidin-7-yl]amino]ethyl]phenyl]-3-[(3E)-hexa-1,3,5-trien-3-yl]urea |
| SMILES | C=C/C=C(\C=C)NC(=O)Nc1ccc(CCNc2ncnc3oc(-c4ccc(OCCN(CC)CCO)cc4)nc23)cc1 |
| InChI | InChI=1S/C32H37N7O4/c1-4-7-25(5-2)36-32(41)37-26-12-8-23(9-13-26)16-17-33-29-28-31(35-22-34-29)43-30(38-28)24-10-14-27(15-11-24)42-21-19-39(6-3)18-20-40/h4-5,7-15,22,40H,1-2,6,16-21H2,3H3,(H,33,34,35)(H2,36,37,41)/b25-7+ |
| InChIKey | RDBSDGYPOWZVGG-JRXWSOMVSA-N |
| XLogP | 5.01 |
| TPSA | 137.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.69 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|