About (3S)-3-(2-tert-butylsulfanylethyl)oxolane;dihydrate
(3S)-3-(2-tert-butylsulfanylethyl)oxolane;dihydrate (PubChem CID 143964769) has the molecular formula C10H24O3S
and a molecular weight of 224.37 g/mol. Its IUPAC name is (3S)-3-(2-tert-butylsulfanylethyl)oxolane;dihydrate.
Molecular Properties
| Compound Name | (3S)-3-(2-tert-butylsulfanylethyl)oxolane;dihydrate |
| PubChem CID | 143964769 |
| Molecular Formula | C10H24O3S |
| Molecular Weight | 224.37 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | (3S)-3-(2-tert-butylsulfanylethyl)oxolane;dihydrate |
| SMILES | CC(C)(C)SCC[C@@H]1CCOC1.O.O |
| InChI | InChI=1S/C10H20OS.2H2O/c1-10(2,3)12-7-5-9-4-6-11-8-9;;/h9H,4-8H2,1-3H3;2*1H2/t9-;;/m0../s1 |
| InChIKey | GCTSUYQINMSVEG-WWPIYYJJSA-N |
| XLogP | 1.30 |
| TPSA | 72.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.37 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S)-3-(2-tert-butylsulfanylethyl)oxolane;dihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-(2-tert-butylsulfanylethyl)oxolane;dihydrate?
The IUPAC name of (3S)-3-(2-tert-butylsulfanylethyl)oxolane;dihydrate (CID 143964769) is (3S)-3-(2-tert-butylsulfanylethyl)oxolane;dihydrate.
What is the SMILES notation for (3S)-3-(2-tert-butylsulfanylethyl)oxolane;dihydrate?
The canonical SMILES for (3S)-3-(2-tert-butylsulfanylethyl)oxolane;dihydrate is CC(C)(C)SCC[C@@H]1CCOC1.O.O.
What is the InChIKey of (3S)-3-(2-tert-butylsulfanylethyl)oxolane;dihydrate?
The InChIKey is GCTSUYQINMSVEG-WWPIYYJJSA-N. The full InChI is InChI=1S/C10H20OS.2H2O/c1-10(2,3)12-7-5-9-4-6-11-8-9;;/h9H,4-8H2,1-3H3;2*1H2/t9-;;/m0../s1.
What are the key properties of (3S)-3-(2-tert-butylsulfanylethyl)oxolane;dihydrate?
(3S)-3-(2-tert-butylsulfanylethyl)oxolane;dihydrate has a molecular weight of 224.37 g/mol, XLogP of 1.30, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-(2-tert-butylsulfanylethyl)oxolane;dihydrate is sourced from PubChem (CID 143964769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).