C9H13NO2 — CID 14396551
(1S,5R)-2-methyl-2-azabicyclo[3.3.1]nonane-3,7-dione (PubChem CID 14396551) has the molecular formula C9H13NO2 and a molecular weight of 167.21 g/mol. Its IUPAC name is (1S,5R)-2-methyl-2-azabicyclo[3.3.1]nonane-3,7-dione.
| Compound Name | (1S,5R)-2-methyl-2-azabicyclo[3.3.1]nonane-3,7-dione |
|---|---|
| PubChem CID | 14396551 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | (1S,5R)-2-methyl-2-azabicyclo[3.3.1]nonane-3,7-dione |
| SMILES | CN1C(=O)C[C@H]2CC(=O)C[C@@H]1C2 |
| InChI | InChI=1S/C9H13NO2/c1-10-7-2-6(4-9(10)12)3-8(11)5-7/h6-7H,2-5H2,1H3/t6-,7+/m1/s1 |
| InChIKey | RJXKQLHBNCMXCM-RQJHMYQMSA-N |
| XLogP | 0.59 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |