C25H33NO3 — CID 143966206
cyclohexyl (4aR,8S)-4a-methyl-1-oxo-2-(2-phenylethyl)-4,7,8,8a-tetrahydro-3H-isoquinoline-8-carboxylate (PubChem CID 143966206) has the molecular formula C25H33NO3 and a molecular weight of 395.54 g/mol. Its IUPAC name is cyclohexyl (4aR,8S)-4a-methyl-1-oxo-2-(2-phenylethyl)-4,7,8,8a-tetrahydro-3H-isoquinoline-8-carboxylate.
| Compound Name | cyclohexyl (4aR,8S)-4a-methyl-1-oxo-2-(2-phenylethyl)-4,7,8,8a-tetrahydro-3H-isoquinoline-8-carboxylate |
|---|---|
| PubChem CID | 143966206 |
| Molecular Formula | C25H33NO3 |
| Molecular Weight | 395.54 g/mol |
| Exact Mass | 395.25 |
| IUPAC Name | cyclohexyl (4aR,8S)-4a-methyl-1-oxo-2-(2-phenylethyl)-4,7,8,8a-tetrahydro-3H-isoquinoline-8-carboxylate |
| SMILES | C[C@@]12C=CC[C@H](C(=O)OC3CCCCC3)C1C(=O)N(CCc1ccccc1)CC2 |
| InChI | InChI=1S/C25H33NO3/c1-25-15-8-13-21(24(28)29-20-11-6-3-7-12-20)22(25)23(27)26(18-16-25)17-14-19-9-4-2-5-10-19/h2,4-5,8-10,15,20-22H,3,6-7,11-14,16-18H2,1H3/t21-,22?,25-/m0/s1 |
| InChIKey | LQPGNINVZOPCRH-KOVVYZNRSA-N |
| XLogP | 4.54 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.54 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|