C29H33N3O3S — CID 143966239
ethyl 2-[5-[2-[[benzyl(cyclopropanecarbonyl)amino]methyl]-4-[(methylsulfanylamino)methyl]phenyl]-3-pyridinyl]acetate (PubChem CID 143966239) has the molecular formula C29H33N3O3S and a molecular weight of 503.67 g/mol. Its IUPAC name is ethyl 2-[5-[2-[[benzyl(cyclopropanecarbonyl)amino]methyl]-4-[(methylsulfanylamino)methyl]phenyl]-3-pyridinyl]acetate.
| Compound Name | ethyl 2-[5-[2-[[benzyl(cyclopropanecarbonyl)amino]methyl]-4-[(methylsulfanylamino)methyl]phenyl]-3-pyridinyl]acetate |
|---|---|
| PubChem CID | 143966239 |
| Molecular Formula | C29H33N3O3S |
| Molecular Weight | 503.67 g/mol |
| Exact Mass | 503.22 |
| IUPAC Name | ethyl 2-[5-[2-[[benzyl(cyclopropanecarbonyl)amino]methyl]-4-[(methylsulfanylamino)methyl]phenyl]-3-pyridinyl]acetate |
| SMILES | CCOC(=O)Cc1cncc(-c2ccc(CNSC)cc2CN(Cc2ccccc2)C(=O)C2CC2)c1 |
| InChI | InChI=1S/C29H33N3O3S/c1-3-35-28(33)15-23-14-25(18-30-16-23)27-12-9-22(17-31-36-2)13-26(27)20-32(29(34)24-10-11-24)19-21-7-5-4-6-8-21/h4-9,12-14,16,18,24,31H,3,10-11,15,17,19-20H2,1-2H3 |
| InChIKey | HNMZULDRLVBHFL-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.67 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|