C19H27N3O — CID 143966240
ethane;N-ethyl-N-[(2-methyl-5-pyrazol-1-ylphenyl)methyl]cyclopropanecarboxamide (PubChem CID 143966240) has the molecular formula C19H27N3O and a molecular weight of 313.45 g/mol. Its IUPAC name is ethane;N-ethyl-N-[(2-methyl-5-pyrazol-1-ylphenyl)methyl]cyclopropanecarboxamide.
| Compound Name | ethane;N-ethyl-N-[(2-methyl-5-pyrazol-1-ylphenyl)methyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 143966240 |
| Molecular Formula | C19H27N3O |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.22 |
| IUPAC Name | ethane;N-ethyl-N-[(2-methyl-5-pyrazol-1-ylphenyl)methyl]cyclopropanecarboxamide |
| SMILES | CC.CCN(Cc1cc(-n2cccn2)ccc1C)C(=O)C1CC1 |
| InChI | InChI=1S/C17H21N3O.C2H6/c1-3-19(17(21)14-6-7-14)12-15-11-16(8-5-13(15)2)20-10-4-9-18-20;1-2/h4-5,8-11,14H,3,6-7,12H2,1-2H3;1-2H3 |
| InChIKey | BMSBOPVSVYVZLS-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |