About methyl (4R)-4-[(2R,4S)-4-hydroxy-6-methylheptan-2-yl]cyclohexene-1-carboxylate
methyl (4R)-4-[(2R,4S)-4-hydroxy-6-methylheptan-2-yl]cyclohexene-1-carboxylate (PubChem CID 14396630) has the molecular formula C16H28O3
and a molecular weight of 268.40 g/mol. Its IUPAC name is methyl (4R)-4-[(2R,4S)-4-hydroxy-6-methylheptan-2-yl]cyclohexene-1-carboxylate.
Molecular Properties
| Compound Name | methyl (4R)-4-[(2R,4S)-4-hydroxy-6-methylheptan-2-yl]cyclohexene-1-carboxylate |
| PubChem CID | 14396630 |
| Molecular Formula | C16H28O3 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | methyl (4R)-4-[(2R,4S)-4-hydroxy-6-methylheptan-2-yl]cyclohexene-1-carboxylate |
| SMILES | COC(=O)C1=CC[C@H]([C@H](C)C[C@@H](O)CC(C)C)CC1 |
| InChI | InChI=1S/C16H28O3/c1-11(2)9-15(17)10-12(3)13-5-7-14(8-6-13)16(18)19-4/h7,11-13,15,17H,5-6,8-10H2,1-4H3/t12-,13+,15+/m1/s1 |
| InChIKey | KVQQCXYORPHUQU-IPYPFGDCSA-N |
| XLogP | 3.32 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl (4R)-4-[(2R,4S)-4-hydroxy-6-methylheptan-2-yl]cyclohexene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (4R)-4-[(2R,4S)-4-hydroxy-6-methylheptan-2-yl]cyclohexene-1-carboxylate?
The IUPAC name of methyl (4R)-4-[(2R,4S)-4-hydroxy-6-methylheptan-2-yl]cyclohexene-1-carboxylate (CID 14396630) is methyl (4R)-4-[(2R,4S)-4-hydroxy-6-methylheptan-2-yl]cyclohexene-1-carboxylate.
What is the SMILES notation for methyl (4R)-4-[(2R,4S)-4-hydroxy-6-methylheptan-2-yl]cyclohexene-1-carboxylate?
The canonical SMILES for methyl (4R)-4-[(2R,4S)-4-hydroxy-6-methylheptan-2-yl]cyclohexene-1-carboxylate is COC(=O)C1=CC[C@H]([C@H](C)C[C@@H](O)CC(C)C)CC1.
What is the InChIKey of methyl (4R)-4-[(2R,4S)-4-hydroxy-6-methylheptan-2-yl]cyclohexene-1-carboxylate?
The InChIKey is KVQQCXYORPHUQU-IPYPFGDCSA-N. The full InChI is InChI=1S/C16H28O3/c1-11(2)9-15(17)10-12(3)13-5-7-14(8-6-13)16(18)19-4/h7,11-13,15,17H,5-6,8-10H2,1-4H3/t12-,13+,15+/m1/s1.
What are the key properties of methyl (4R)-4-[(2R,4S)-4-hydroxy-6-methylheptan-2-yl]cyclohexene-1-carboxylate?
methyl (4R)-4-[(2R,4S)-4-hydroxy-6-methylheptan-2-yl]cyclohexene-1-carboxylate has a molecular weight of 268.40 g/mol, XLogP of 3.32, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (4R)-4-[(2R,4S)-4-hydroxy-6-methylheptan-2-yl]cyclohexene-1-carboxylate is sourced from PubChem (CID 14396630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).