C26H23F2N2O4- — CID 143966672
N-[1'-[(2,4-difluorophenyl)methyl]-8-methoxy-3',3'-dimethylspiro[chromene-2,2'-indole]-6-yl]-N-oxidohydroxylamine (PubChem CID 143966672) has the molecular formula C26H23F2N2O4- and a molecular weight of 465.48 g/mol. Its IUPAC name is N-[1'-[(2,4-difluorophenyl)methyl]-8-methoxy-3',3'-dimethylspiro[chromene-2,2'-indole]-6-yl]-N-oxidohydroxylamine.
| Compound Name | N-[1'-[(2,4-difluorophenyl)methyl]-8-methoxy-3',3'-dimethylspiro[chromene-2,2'-indole]-6-yl]-N-oxidohydroxylamine |
|---|---|
| PubChem CID | 143966672 |
| Molecular Formula | C26H23F2N2O4- |
| Molecular Weight | 465.48 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | N-[1'-[(2,4-difluorophenyl)methyl]-8-methoxy-3',3'-dimethylspiro[chromene-2,2'-indole]-6-yl]-N-oxidohydroxylamine |
| SMILES | COc1cc(N([O-])O)cc2c1OC1(C=C2)N(Cc2ccc(F)cc2F)c2ccccc2C1(C)C |
| InChI | InChI=1S/C26H23F2N2O4/c1-25(2)20-6-4-5-7-22(20)29(15-17-8-9-18(27)13-21(17)28)26(25)11-10-16-12-19(30(31)32)14-23(33-3)24(16)34-26/h4-14,31H,15H2,1-3H3/q-1 |
| InChIKey | KJCJCWAEHNYWGY-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.48 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|