About 1,1'-biphenyl;N-(oxan-4-yl)propane-2-sulfonamide
1,1'-biphenyl;N-(oxan-4-yl)propane-2-sulfonamide (PubChem CID 143967417) has the molecular formula C20H27NO3S
and a molecular weight of 361.51 g/mol. Its IUPAC name is 1,1'-biphenyl;N-(oxan-4-yl)propane-2-sulfonamide.
Molecular Properties
| Compound Name | 1,1'-biphenyl;N-(oxan-4-yl)propane-2-sulfonamide |
| PubChem CID | 143967417 |
| Molecular Formula | C20H27NO3S |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | 1,1'-biphenyl;N-(oxan-4-yl)propane-2-sulfonamide |
| SMILES | CC(C)S(=O)(=O)NC1CCOCC1.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C8H17NO3S/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-7(2)13(10,11)9-8-3-5-12-6-4-8/h1-10H;7-9H,3-6H2,1-2H3 |
| InChIKey | IDHYHFNQTMMZHZ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,1'-biphenyl;N-(oxan-4-yl)propane-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1'-biphenyl;N-(oxan-4-yl)propane-2-sulfonamide?
The IUPAC name of 1,1'-biphenyl;N-(oxan-4-yl)propane-2-sulfonamide (CID 143967417) is 1,1'-biphenyl;N-(oxan-4-yl)propane-2-sulfonamide.
What is the SMILES notation for 1,1'-biphenyl;N-(oxan-4-yl)propane-2-sulfonamide?
The canonical SMILES for 1,1'-biphenyl;N-(oxan-4-yl)propane-2-sulfonamide is CC(C)S(=O)(=O)NC1CCOCC1.c1ccc(-c2ccccc2)cc1.
What is the InChIKey of 1,1'-biphenyl;N-(oxan-4-yl)propane-2-sulfonamide?
The InChIKey is IDHYHFNQTMMZHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.C8H17NO3S/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-7(2)13(10,11)9-8-3-5-12-6-4-8/h1-10H;7-9H,3-6H2,1-2H3.
What are the key properties of 1,1'-biphenyl;N-(oxan-4-yl)propane-2-sulfonamide?
1,1'-biphenyl;N-(oxan-4-yl)propane-2-sulfonamide has a molecular weight of 361.51 g/mol, XLogP of 3.85, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1'-biphenyl;N-(oxan-4-yl)propane-2-sulfonamide is sourced from PubChem (CID 143967417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).