C14H13F2NO2 — CID 143967463
ethyl (2E)-2-[(2,4-difluorophenyl)-(methylideneamino)methylidene]but-3-enoate (PubChem CID 143967463) has the molecular formula C14H13F2NO2 and a molecular weight of 265.26 g/mol. Its IUPAC name is ethyl (2E)-2-[(2,4-difluorophenyl)-(methylideneamino)methylidene]but-3-enoate.
| Compound Name | ethyl (2E)-2-[(2,4-difluorophenyl)-(methylideneamino)methylidene]but-3-enoate |
|---|---|
| PubChem CID | 143967463 |
| Molecular Formula | C14H13F2NO2 |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | ethyl (2E)-2-[(2,4-difluorophenyl)-(methylideneamino)methylidene]but-3-enoate |
| SMILES | C=C/C(C(=O)OCC)=C(\N=C)c1ccc(F)cc1F |
| InChI | InChI=1S/C14H13F2NO2/c1-4-10(14(18)19-5-2)13(17-3)11-7-6-9(15)8-12(11)16/h4,6-8H,1,3,5H2,2H3/b13-10+ |
| InChIKey | GYYKQMBNPMMZFA-JLHYYAGUSA-N |
| XLogP | 3.13 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|