About CID 143968089
CID 143968089 (PubChem CID 143968089) has the molecular formula C49H54N7O3S2+
and a molecular weight of 853.15 g/mol.
Molecular Properties
| Compound Name | CID 143968089 |
| PubChem CID | 143968089 |
| Molecular Formula | C49H54N7O3S2+ |
| Molecular Weight | 853.15 g/mol |
| Exact Mass | 852.37 |
| IUPAC Name | — |
| SMILES | CCSN1CCC(Nc2cc(-c3ccc(OC)c(OCc4cc5cc(-c6ccc(C#N)c(C)c6)cc(NC6CCN([SH+](=O)C7CC7)CC6)c5cn4)c3)cc3ccncc23)CC1 |
| InChI | InChI=1S/C49H53N7O3S2/c1-4-60-55-17-12-40(13-18-55)53-46-25-37(22-35-11-16-51-29-44(35)46)34-7-10-48(58-3)49(27-34)59-31-42-24-39-23-38(33-5-6-36(28-50)32(2)21-33)26-47(45(39)30-52-42)54-41-14-19-56(20-15-41)61(57)43-8-9-43/h5-7,10-11,16,21-27,29-30,40-41,43,53-54H,4,8-9,12-15,17-20,31H2,1-3H3/p+1 |
| InChIKey | AXPYMTXSSWFCRS-UHFFFAOYSA-O |
| XLogP | 10.08 |
| TPSA | 115.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 61 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 853.15 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze CID 143968089 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 143968089?
The IUPAC name of CID 143968089 (CID 143968089) is not available.
What is the SMILES notation for CID 143968089?
The canonical SMILES for CID 143968089 is CCSN1CCC(Nc2cc(-c3ccc(OC)c(OCc4cc5cc(-c6ccc(C#N)c(C)c6)cc(NC6CCN([SH+](=O)C7CC7)CC6)c5cn4)c3)cc3ccncc23)CC1.
What is the InChIKey of CID 143968089?
The InChIKey is AXPYMTXSSWFCRS-UHFFFAOYSA-O. The full InChI is InChI=1S/C49H53N7O3S2/c1-4-60-55-17-12-40(13-18-55)53-46-25-37(22-35-11-16-51-29-44(35)46)34-7-10-48(58-3)49(27-34)59-31-42-24-39-23-38(33-5-6-36(28-50)32(2)21-33)26-47(45(39)30-52-42)54-41-14-19-56(20-15-41)61(57)43-8-9-43/h5-7,10-11,16,21-27,29-30,40-41,43,53-54H,4,8-9,12-15,17-20,31H2,1-3H3/p+1.
What are the key properties of CID 143968089?
CID 143968089 has a molecular weight of 853.15 g/mol, XLogP of 10.08, 14 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 143968089 is sourced from PubChem (CID 143968089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).