C18H19NOS2 — CID 143968405
2-cyclohepta-1,3,6-trien-1-yl-2-imino-1-[2-methyl-4,5-bis(methylsulfanyl)phenyl]ethanone (PubChem CID 143968405) has the molecular formula C18H19NOS2 and a molecular weight of 329.49 g/mol. Its IUPAC name is 2-cyclohepta-1,3,6-trien-1-yl-2-imino-1-[2-methyl-4,5-bis(methylsulfanyl)phenyl]ethanone.
| Compound Name | 2-cyclohepta-1,3,6-trien-1-yl-2-imino-1-[2-methyl-4,5-bis(methylsulfanyl)phenyl]ethanone |
|---|---|
| PubChem CID | 143968405 |
| Molecular Formula | C18H19NOS2 |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 2-cyclohepta-1,3,6-trien-1-yl-2-imino-1-[2-methyl-4,5-bis(methylsulfanyl)phenyl]ethanone |
| SMILES | [H]/N=C(/C(=O)c1cc(SC)c(SC)cc1C)C1=CC=CCC=C1 |
| InChI | InChI=1S/C18H19NOS2/c1-12-10-15(21-2)16(22-3)11-14(12)18(20)17(19)13-8-6-4-5-7-9-13/h4,6-11,19H,5H2,1-3H3/b19-17+ |
| InChIKey | NQHGYOKIXXKPRZ-HTXNQAPBSA-N |
| XLogP | 5.08 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|