C18H22N2O — CID 143969035
N-[(E)-3a,7a-dihydro-3H-inden-1-ylmethylideneamino]-2-(cyclohexen-1-yl)acetamide (PubChem CID 143969035) has the molecular formula C18H22N2O and a molecular weight of 282.39 g/mol. Its IUPAC name is N-[(E)-3a,7a-dihydro-3H-inden-1-ylmethylideneamino]-2-(cyclohexen-1-yl)acetamide.
| Compound Name | N-[(E)-3a,7a-dihydro-3H-inden-1-ylmethylideneamino]-2-(cyclohexen-1-yl)acetamide |
|---|---|
| PubChem CID | 143969035 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | N-[(E)-3a,7a-dihydro-3H-inden-1-ylmethylideneamino]-2-(cyclohexen-1-yl)acetamide |
| SMILES | O=C(CC1=CCCCC1)N/N=C/C1=CCC2C=CC=CC12 |
| InChI | InChI=1S/C18H22N2O/c21-18(12-14-6-2-1-3-7-14)20-19-13-16-11-10-15-8-4-5-9-17(15)16/h4-6,8-9,11,13,15,17H,1-3,7,10,12H2,(H,20,21)/b19-13+ |
| InChIKey | GUJGWLOWSFUAQM-CPNJWEJPSA-N |
| XLogP | 3.67 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|