About 6-[4-cyclohexyloxy-3-(methylideneamino)phenyl]-1,4-dihydro-3,1-benzoxazin-2-one
6-[4-cyclohexyloxy-3-(methylideneamino)phenyl]-1,4-dihydro-3,1-benzoxazin-2-one (PubChem CID 143969102) has the molecular formula C21H22N2O3
and a molecular weight of 350.42 g/mol. Its IUPAC name is 6-[4-cyclohexyloxy-3-(methylideneamino)phenyl]-1,4-dihydro-3,1-benzoxazin-2-one.
Molecular Properties
| Compound Name | 6-[4-cyclohexyloxy-3-(methylideneamino)phenyl]-1,4-dihydro-3,1-benzoxazin-2-one |
| PubChem CID | 143969102 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 6-[4-cyclohexyloxy-3-(methylideneamino)phenyl]-1,4-dihydro-3,1-benzoxazin-2-one |
| SMILES | C=Nc1cc(-c2ccc3c(c2)COC(=O)N3)ccc1OC1CCCCC1 |
| InChI | InChI=1S/C21H22N2O3/c1-22-19-12-15(8-10-20(19)26-17-5-3-2-4-6-17)14-7-9-18-16(11-14)13-25-21(24)23-18/h7-12,17H,1-6,13H2,(H,23,24) |
| InChIKey | BOEYZALPILBJTN-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 6-[4-cyclohexyloxy-3-(methylideneamino)phenyl]-1,4-dihydro-3,1-benzoxazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[4-cyclohexyloxy-3-(methylideneamino)phenyl]-1,4-dihydro-3,1-benzoxazin-2-one?
The IUPAC name of 6-[4-cyclohexyloxy-3-(methylideneamino)phenyl]-1,4-dihydro-3,1-benzoxazin-2-one (CID 143969102) is 6-[4-cyclohexyloxy-3-(methylideneamino)phenyl]-1,4-dihydro-3,1-benzoxazin-2-one.
What is the SMILES notation for 6-[4-cyclohexyloxy-3-(methylideneamino)phenyl]-1,4-dihydro-3,1-benzoxazin-2-one?
The canonical SMILES for 6-[4-cyclohexyloxy-3-(methylideneamino)phenyl]-1,4-dihydro-3,1-benzoxazin-2-one is C=Nc1cc(-c2ccc3c(c2)COC(=O)N3)ccc1OC1CCCCC1.
What is the InChIKey of 6-[4-cyclohexyloxy-3-(methylideneamino)phenyl]-1,4-dihydro-3,1-benzoxazin-2-one?
The InChIKey is BOEYZALPILBJTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N2O3/c1-22-19-12-15(8-10-20(19)26-17-5-3-2-4-6-17)14-7-9-18-16(11-14)13-25-21(24)23-18/h7-12,17H,1-6,13H2,(H,23,24).
What are the key properties of 6-[4-cyclohexyloxy-3-(methylideneamino)phenyl]-1,4-dihydro-3,1-benzoxazin-2-one?
6-[4-cyclohexyloxy-3-(methylideneamino)phenyl]-1,4-dihydro-3,1-benzoxazin-2-one has a molecular weight of 350.42 g/mol, XLogP of 5.46, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[4-cyclohexyloxy-3-(methylideneamino)phenyl]-1,4-dihydro-3,1-benzoxazin-2-one is sourced from PubChem (CID 143969102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).