C28H43NO4 — CID 143969207
(2S)-2-[(1R,15R,16R)-11,15-dimethoxy-13-oxahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-16-yl]-3,3-dimethylbutan-2-ol;methanamine (PubChem CID 143969207) has the molecular formula C28H43NO4 and a molecular weight of 457.66 g/mol. Its IUPAC name is (2S)-2-[(1R,15R,16R)-11,15-dimethoxy-13-oxahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-16-yl]-3,3-dimethylbutan-2-ol;methanamine.
| Compound Name | (2S)-2-[(1R,15R,16R)-11,15-dimethoxy-13-oxahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-16-yl]-3,3-dimethylbutan-2-ol;methanamine |
|---|---|
| PubChem CID | 143969207 |
| Molecular Formula | C28H43NO4 |
| Molecular Weight | 457.66 g/mol |
| Exact Mass | 457.32 |
| IUPAC Name | (2S)-2-[(1R,15R,16R)-11,15-dimethoxy-13-oxahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-16-yl]-3,3-dimethylbutan-2-ol;methanamine |
| SMILES | CN.COc1ccc2c3c1OC1C34CCCC(C2)[C@]42CC[C@@]1(OC)[C@@H]([C@](C)(O)C(C)(C)C)C2 |
| InChI | InChI=1S/C27H38O4.CH5N/c1-23(2,3)24(4,28)19-15-25-12-13-27(19,30-6)22-26(25)11-7-8-17(25)14-16-9-10-18(29-5)21(31-22)20(16)26;1-2/h9-10,17,19,22,28H,7-8,11-15H2,1-6H3;2H2,1H3/t17?,19-,22?,24+,25-,26?,27-;/m1./s1 |
| InChIKey | TWROVWHAXAGWGI-KIDUZUASSA-N |
| XLogP | 4.61 |
| TPSA | 73.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.66 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |