C42H90N6O8P2S2 — CID 143969863
S-[bis[di(propan-2-yl)amino]phosphanyloxymethoxymethoxymethyl] 3-(dimethylamino)propanethioate;S-[bis[di(propan-2-yl)amino]phosphanyloxymethoxymethoxymethyl] 1-methylpiperidine-4-carbothioate (PubChem CID 143969863) has the molecular formula C42H90N6O8P2S2 and a molecular weight of 933.30 g/mol. Its IUPAC name is S-[bis[di(propan-2-yl)amino]phosphanyloxymethoxymethoxymethyl] 3-(dimethylamino)propanethioate;S-[bis[di(propan-2-yl)amino]phosphanyloxymethoxymethoxymethyl] 1-methylpiperidine-4-carbothioate.
| Compound Name | S-[bis[di(propan-2-yl)amino]phosphanyloxymethoxymethoxymethyl] 3-(dimethylamino)propanethioate;S-[bis[di(propan-2-yl)amino]phosphanyloxymethoxymethoxymethyl] 1-methylpiperidine-4-carbothioate |
|---|---|
| PubChem CID | 143969863 |
| Molecular Formula | C42H90N6O8P2S2 |
| Molecular Weight | 933.30 g/mol |
| Exact Mass | 932.57 |
| IUPAC Name | S-[bis[di(propan-2-yl)amino]phosphanyloxymethoxymethoxymethyl] 3-(dimethylamino)propanethioate;S-[bis[di(propan-2-yl)amino]phosphanyloxymethoxymethoxymethyl] 1-methylpiperidine-4-carbothioate |
| SMILES | CC(C)N(C(C)C)P(OCOCOCSC(=O)C1CCN(C)CC1)N(C(C)C)C(C)C.CC(C)N(C(C)C)P(OCOCOCSC(=O)CCN(C)C)N(C(C)C)C(C)C |
| InChI | InChI=1S/C22H46N3O4PS.C20H44N3O4PS/c1-17(2)24(18(3)4)30(25(19(5)6)20(7)8)29-15-27-14-28-16-31-22(26)21-10-12-23(9)13-11-21;1-16(2)22(17(3)4)28(23(18(5)6)19(7)8)27-14-25-13-26-15-29-20(24)11-12-21(9)10/h17-21H,10-16H2,1-9H3;16-19H,11-15H2,1-10H3 |
| InChIKey | MTGLWSKXLWMUFW-UHFFFAOYSA-N |
| XLogP | 9.56 |
| TPSA | 108.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 933.30 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|