C38H51NO — CID 143970081
2,4-diethyl-1-methylbenzene;1-(2,3-dihydropyridin-6-yl)-8-phenyloctan-4-one;ethylbenzene (PubChem CID 143970081) has the molecular formula C38H51NO and a molecular weight of 537.83 g/mol. Its IUPAC name is 2,4-diethyl-1-methylbenzene;1-(2,3-dihydropyridin-6-yl)-8-phenyloctan-4-one;ethylbenzene.
| Compound Name | 2,4-diethyl-1-methylbenzene;1-(2,3-dihydropyridin-6-yl)-8-phenyloctan-4-one;ethylbenzene |
|---|---|
| PubChem CID | 143970081 |
| Molecular Formula | C38H51NO |
| Molecular Weight | 537.83 g/mol |
| Exact Mass | 537.40 |
| IUPAC Name | 2,4-diethyl-1-methylbenzene;1-(2,3-dihydropyridin-6-yl)-8-phenyloctan-4-one;ethylbenzene |
| SMILES | CCc1ccc(C)c(CC)c1.CCc1ccccc1.O=C(CCCCc1ccccc1)CCCC1=NCCC=C1 |
| InChI | InChI=1S/C19H25NO.C11H16.C8H10/c21-19(15-8-13-18-12-6-7-16-20-18)14-5-4-11-17-9-2-1-3-10-17;1-4-10-7-6-9(3)11(5-2)8-10;1-2-8-6-4-3-5-7-8/h1-3,6,9-10,12H,4-5,7-8,11,13-16H2;6-8H,4-5H2,1-3H3;3-7H,2H2,1H3 |
| InChIKey | UBQFTXHKYXUWNB-UHFFFAOYSA-N |
| XLogP | 9.91 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.83 |
| LogP ≤ 5 | 9.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|