C32H35NO3 — CID 143970098
(E)-3-(2,4-dimethoxy-6-pent-4-enylphenyl)-2-methyl-6-(4-phenoxyphenyl)hex-2-enenitrile (PubChem CID 143970098) has the molecular formula C32H35NO3 and a molecular weight of 481.64 g/mol. Its IUPAC name is (E)-3-(2,4-dimethoxy-6-pent-4-enylphenyl)-2-methyl-6-(4-phenoxyphenyl)hex-2-enenitrile.
| Compound Name | (E)-3-(2,4-dimethoxy-6-pent-4-enylphenyl)-2-methyl-6-(4-phenoxyphenyl)hex-2-enenitrile |
|---|---|
| PubChem CID | 143970098 |
| Molecular Formula | C32H35NO3 |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.26 |
| IUPAC Name | (E)-3-(2,4-dimethoxy-6-pent-4-enylphenyl)-2-methyl-6-(4-phenoxyphenyl)hex-2-enenitrile |
| SMILES | C=CCCCc1cc(OC)cc(OC)c1/C(CCCc1ccc(Oc2ccccc2)cc1)=C(\C)C#N |
| InChI | InChI=1S/C32H35NO3/c1-5-6-8-13-26-21-29(34-3)22-31(35-4)32(26)30(24(2)23-33)16-11-12-25-17-19-28(20-18-25)36-27-14-9-7-10-15-27/h5,7,9-10,14-15,17-22H,1,6,8,11-13,16H2,2-4H3/b30-24+ |
| InChIKey | VEMSZBNYJRHHTM-BGABXYSRSA-N |
| XLogP | 8.32 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|