C31H40ClN7O2 — CID 143970539
N-[(2Z)-2-amino-2-(iminohydrazinylidene)ethyl]-4-[1-[2-(3-chlorophenyl)-7,9-dimethyl-3-oxo-1,4-diazaspiro[4.5]dec-1-en-4-yl]-4-methylpentyl]benzamide (PubChem CID 143970539) has the molecular formula C31H40ClN7O2 and a molecular weight of 578.16 g/mol. Its IUPAC name is N-[(2Z)-2-amino-2-(iminohydrazinylidene)ethyl]-4-[1-[2-(3-chlorophenyl)-7,9-dimethyl-3-oxo-1,4-diazaspiro[4.5]dec-1-en-4-yl]-4-methylpentyl]benzamide.
| Compound Name | N-[(2Z)-2-amino-2-(iminohydrazinylidene)ethyl]-4-[1-[2-(3-chlorophenyl)-7,9-dimethyl-3-oxo-1,4-diazaspiro[4.5]dec-1-en-4-yl]-4-methylpentyl]benzamide |
|---|---|
| PubChem CID | 143970539 |
| Molecular Formula | C31H40ClN7O2 |
| Molecular Weight | 578.16 g/mol |
| Exact Mass | 577.29 |
| IUPAC Name | N-[(2Z)-2-amino-2-(iminohydrazinylidene)ethyl]-4-[1-[2-(3-chlorophenyl)-7,9-dimethyl-3-oxo-1,4-diazaspiro[4.5]dec-1-en-4-yl]-4-methylpentyl]benzamide |
| SMILES | [H]/N=N/N=C(\N)CNC(=O)c1ccc(C(CCC(C)C)N2C(=O)C(c3cccc(Cl)c3)=NC23CC(C)CC(C)C3)cc1 |
| InChI | InChI=1S/C31H40ClN7O2/c1-19(2)8-13-26(22-9-11-23(12-10-22)29(40)35-18-27(33)37-38-34)39-30(41)28(24-6-5-7-25(32)15-24)36-31(39)16-20(3)14-21(4)17-31/h5-7,9-12,15,19-21,26H,8,13-14,16-18H2,1-4H3,(H,35,40)(H3,33,34,37) |
| InChIKey | TYCMZFGUPDGCCP-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 136.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.16 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|