C33H42F3N3O5 — CID 143970739
3-[[4-[1-[8-tert-butyl-3-oxo-2-[(3E,5Z)-2-(trifluoromethyl)hepta-1,3,5-trien-4-yl]-1,4-diazaspiro[4.5]dec-1-en-4-yl]-2-hydroxypropan-2-yl]benzoyl]amino]propanoic acid (PubChem CID 143970739) has the molecular formula C33H42F3N3O5 and a molecular weight of 617.71 g/mol. Its IUPAC name is 3-[[4-[1-[8-tert-butyl-3-oxo-2-[(3E,5Z)-2-(trifluoromethyl)hepta-1,3,5-trien-4-yl]-1,4-diazaspiro[4.5]dec-1-en-4-yl]-2-hydroxypropan-2-yl]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[1-[8-tert-butyl-3-oxo-2-[(3E,5Z)-2-(trifluoromethyl)hepta-1,3,5-trien-4-yl]-1,4-diazaspiro[4.5]dec-1-en-4-yl]-2-hydroxypropan-2-yl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 143970739 |
| Molecular Formula | C33H42F3N3O5 |
| Molecular Weight | 617.71 g/mol |
| Exact Mass | 617.31 |
| IUPAC Name | 3-[[4-[1-[8-tert-butyl-3-oxo-2-[(3E,5Z)-2-(trifluoromethyl)hepta-1,3,5-trien-4-yl]-1,4-diazaspiro[4.5]dec-1-en-4-yl]-2-hydroxypropan-2-yl]benzoyl]amino]propanoic acid |
| SMILES | C=C(/C=C(\C=C/C)C1=NC2(CCC(C(C)(C)C)CC2)N(CC(C)(O)c2ccc(C(=O)NCCC(=O)O)cc2)C1=O)C(F)(F)F |
| InChI | InChI=1S/C33H42F3N3O5/c1-7-8-23(19-21(2)33(34,35)36)27-29(43)39(32(38-27)16-13-24(14-17-32)30(3,4)5)20-31(6,44)25-11-9-22(10-12-25)28(42)37-18-15-26(40)41/h7-12,19,24,44H,2,13-18,20H2,1,3-6H3,(H,37,42)(H,40,41)/b8-7-,23-19+ |
| InChIKey | ZDKDANFAYKANDG-ASCKGVDRSA-N |
| XLogP | 5.94 |
| TPSA | 119.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.71 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|