C31H42Cl2N7O2+ — CID 143971000
[1-[(Z)-aminodiazenyl]-2-[[4-[(1R)-1-[2-(3,5-dichlorophenyl)-7,9-dimethyl-3-oxo-1,4-diazaspiro[4.5]dec-1-en-4-yl]hexyl]benzoyl]amino]ethyl]azanium (PubChem CID 143971000) has the molecular formula C31H42Cl2N7O2+ and a molecular weight of 615.63 g/mol. Its IUPAC name is [1-[(Z)-aminodiazenyl]-2-[[4-[(1R)-1-[2-(3,5-dichlorophenyl)-7,9-dimethyl-3-oxo-1,4-diazaspiro[4.5]dec-1-en-4-yl]hexyl]benzoyl]amino]ethyl]azanium.
| Compound Name | [1-[(Z)-aminodiazenyl]-2-[[4-[(1R)-1-[2-(3,5-dichlorophenyl)-7,9-dimethyl-3-oxo-1,4-diazaspiro[4.5]dec-1-en-4-yl]hexyl]benzoyl]amino]ethyl]azanium |
|---|---|
| PubChem CID | 143971000 |
| Molecular Formula | C31H42Cl2N7O2+ |
| Molecular Weight | 615.63 g/mol |
| Exact Mass | 614.28 |
| IUPAC Name | [1-[(Z)-aminodiazenyl]-2-[[4-[(1R)-1-[2-(3,5-dichlorophenyl)-7,9-dimethyl-3-oxo-1,4-diazaspiro[4.5]dec-1-en-4-yl]hexyl]benzoyl]amino]ethyl]azanium |
| SMILES | CCCCC[C@H](c1ccc(C(=O)NCC([NH3+])/N=N\N)cc1)N1C(=O)C(c2cc(Cl)cc(Cl)c2)=NC12CC(C)CC(C)C2 |
| InChI | InChI=1S/C31H41Cl2N7O2/c1-4-5-6-7-26(21-8-10-22(11-9-21)29(41)36-18-27(34)38-39-35)40-30(42)28(23-13-24(32)15-25(33)14-23)37-31(40)16-19(2)12-20(3)17-31/h8-11,13-15,19-20,26-27H,4-7,12,16-18,34H2,1-3H3,(H2,35,38)(H,36,41)/p+1/t19?,20?,26-,27?,31?/m1/s1 |
| InChIKey | UMUCAPBNJFCFHE-AUIGHEEVSA-O |
| XLogP | 5.72 |
| TPSA | 140.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.63 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|