C16H29NO3 — CID 143971224
ethane;(3E,5Z,7Z)-2-[3-hydroxybutyl(methyl)amino]nona-3,5,7-trienoic acid (PubChem CID 143971224) has the molecular formula C16H29NO3 and a molecular weight of 283.41 g/mol. Its IUPAC name is ethane;(3E,5Z,7Z)-2-[3-hydroxybutyl(methyl)amino]nona-3,5,7-trienoic acid.
| Compound Name | ethane;(3E,5Z,7Z)-2-[3-hydroxybutyl(methyl)amino]nona-3,5,7-trienoic acid |
|---|---|
| PubChem CID | 143971224 |
| Molecular Formula | C16H29NO3 |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | ethane;(3E,5Z,7Z)-2-[3-hydroxybutyl(methyl)amino]nona-3,5,7-trienoic acid |
| SMILES | C/C=C\C=C/C=C/C(C(=O)O)N(C)CCC(C)O.CC |
| InChI | InChI=1S/C14H23NO3.C2H6/c1-4-5-6-7-8-9-13(14(17)18)15(3)11-10-12(2)16;1-2/h4-9,12-13,16H,10-11H2,1-3H3,(H,17,18);1-2H3/b5-4-,7-6-,9-8+; |
| InChIKey | JLARXYDICBXCRG-GLCIZECGSA-N |
| XLogP | 2.86 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|