C13H20FNO2 — CID 143971253
1-[(3E,5Z)-1-fluoro-1-hydroxyocta-3,5,7-trien-2-yl]piperidin-4-ol (PubChem CID 143971253) has the molecular formula C13H20FNO2 and a molecular weight of 241.31 g/mol. Its IUPAC name is 1-[(3E,5Z)-1-fluoro-1-hydroxyocta-3,5,7-trien-2-yl]piperidin-4-ol.
| Compound Name | 1-[(3E,5Z)-1-fluoro-1-hydroxyocta-3,5,7-trien-2-yl]piperidin-4-ol |
|---|---|
| PubChem CID | 143971253 |
| Molecular Formula | C13H20FNO2 |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | 1-[(3E,5Z)-1-fluoro-1-hydroxyocta-3,5,7-trien-2-yl]piperidin-4-ol |
| SMILES | C=C/C=C\C=C\C(C(O)F)N1CCC(O)CC1 |
| InChI | InChI=1S/C13H20FNO2/c1-2-3-4-5-6-12(13(14)17)15-9-7-11(16)8-10-15/h2-6,11-13,16-17H,1,7-10H2/b4-3-,6-5+ |
| InChIKey | RFFQAMBSQILKJY-DNVGVPOPSA-N |
| XLogP | 1.40 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|