About (2R)-4-[(4-cyclopropyl-2,4-dimethylpentan-2-yl)amino]-2-methylbutan-1-ol
(2R)-4-[(4-cyclopropyl-2,4-dimethylpentan-2-yl)amino]-2-methylbutan-1-ol (PubChem CID 143973005) has the molecular formula C15H31NO
and a molecular weight of 241.42 g/mol. Its IUPAC name is (2R)-4-[(4-cyclopropyl-2,4-dimethylpentan-2-yl)amino]-2-methylbutan-1-ol.
Molecular Properties
| Compound Name | (2R)-4-[(4-cyclopropyl-2,4-dimethylpentan-2-yl)amino]-2-methylbutan-1-ol |
| PubChem CID | 143973005 |
| Molecular Formula | C15H31NO |
| Molecular Weight | 241.42 g/mol |
| Exact Mass | 241.24 |
| IUPAC Name | (2R)-4-[(4-cyclopropyl-2,4-dimethylpentan-2-yl)amino]-2-methylbutan-1-ol |
| SMILES | C[C@@H](CO)CCNC(C)(C)CC(C)(C)C1CC1 |
| InChI | InChI=1S/C15H31NO/c1-12(10-17)8-9-16-15(4,5)11-14(2,3)13-6-7-13/h12-13,16-17H,6-11H2,1-5H3/t12-/m1/s1 |
| InChIKey | CROYHNCIVYWRAD-GFCCVEGCSA-N |
| XLogP | 3.20 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.42 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-4-[(4-cyclopropyl-2,4-dimethylpentan-2-yl)amino]-2-methylbutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-4-[(4-cyclopropyl-2,4-dimethylpentan-2-yl)amino]-2-methylbutan-1-ol?
The IUPAC name of (2R)-4-[(4-cyclopropyl-2,4-dimethylpentan-2-yl)amino]-2-methylbutan-1-ol (CID 143973005) is (2R)-4-[(4-cyclopropyl-2,4-dimethylpentan-2-yl)amino]-2-methylbutan-1-ol.
What is the SMILES notation for (2R)-4-[(4-cyclopropyl-2,4-dimethylpentan-2-yl)amino]-2-methylbutan-1-ol?
The canonical SMILES for (2R)-4-[(4-cyclopropyl-2,4-dimethylpentan-2-yl)amino]-2-methylbutan-1-ol is C[C@@H](CO)CCNC(C)(C)CC(C)(C)C1CC1.
What is the InChIKey of (2R)-4-[(4-cyclopropyl-2,4-dimethylpentan-2-yl)amino]-2-methylbutan-1-ol?
The InChIKey is CROYHNCIVYWRAD-GFCCVEGCSA-N. The full InChI is InChI=1S/C15H31NO/c1-12(10-17)8-9-16-15(4,5)11-14(2,3)13-6-7-13/h12-13,16-17H,6-11H2,1-5H3/t12-/m1/s1.
What are the key properties of (2R)-4-[(4-cyclopropyl-2,4-dimethylpentan-2-yl)amino]-2-methylbutan-1-ol?
(2R)-4-[(4-cyclopropyl-2,4-dimethylpentan-2-yl)amino]-2-methylbutan-1-ol has a molecular weight of 241.42 g/mol, XLogP of 3.20, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-4-[(4-cyclopropyl-2,4-dimethylpentan-2-yl)amino]-2-methylbutan-1-ol is sourced from PubChem (CID 143973005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).